{{Short description|Chemical compound}} {{Drugbox | verifiedrevid = 449872111 | IUPAC_name = 1-(2-ethoxyethyl)-4-phenylpiperidin-4-yl propionate | image = Prosidol.svg | image_class = skin-invert-image | width = 160 | image2 = Prosidol ball-and-stick.png | image_class2 = bg-transparent | width2 = 200
<!--Clinical data--> | tradename = | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_CA = <!-- Schedule I --> | legal_UK = <!-- Class A --> | legal_US = <!-- Schedule I --> | legal_status = | routes_of_administration =
<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
<!--Identifiers--> | CAS_number_Ref = {{cascite|correct|CAS}} | CAS_number = 164231-04-3 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = CV69EOR0N2 | ATC_prefix = none | ATC_suffix = | PubChem = 10402849 | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank = | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 8578287
<!--Chemical data--> | C=18 | H=27 | N=1 | O=3 | smiles = O=C(OC2(c1ccccc1)CCN(CCOCC)CC2)CC | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C18H27NO3/c1-3-17(20)22-18(16-8-6-5-7-9-16)10-12-19(13-11-18)14-15-21-4-2/h5-9H,3-4,10-15H2,1-2H3 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = IOLPYQBYMPDUNK-UHFFFAOYSA-N | synonyms = }}
'''Prosidol''' is an opioid analgesic that is an analogue of prodine. It was originally discovered by J.F. MacFarlan and Co. in the 1950s.<ref>{{cite patent | country = US | number = 2960507 | title = Piperidine compounds }}</ref> It was further developed in Russia in the 1990s during research into the related drug pethidine.<ref name="pmid7802322">{{cite journal | vauthors = Osipova NA, Novikov GA, Vetsheva MS, Prokhorov BM, Beresnev VA, Loseva NA, Zemskaia SI, Smolina TA | title = [First experience in the use of a new Russian narcotic analgesic prosidol in oncology] | language = ru | journal = Anesteziologiia I Reanimatologiia | issue = 4 | pages = 53–7 | date = 1994 | pmid = 7802322 }}</ref>
Prosidol has seen some clinical use, but is still a relatively new drug and does not yet have an extensive history of use. It produces similar effects to other opioids, such as analgesia and sedation, along with side effects such as nausea, itching, vomiting and respiratory depression which may be harmful or fatal.<ref name="pmid8975562">{{cite journal | vauthors = Osipova NA | title = [The problem of opioid tolerance and dependence during clinical use thereof] | language = ru | journal = Anesteziologiia I Reanimatologiia | issue = 4 | pages = 17–21 | date = 1996 | pmid = 8975562 }}</ref><ref name="pmid11757313">{{cite journal | vauthors = Abuzarova GR | title = [Prosidol, an original Russian opioid, in the treatment of pain syndromes] | language = ru | journal = Anesteziologiia I Reanimatologiia | issue = 5 | pages = 74–7 | date = 2001 | pmid = 11757313 }}</ref>
== References == {{Reflist|2}}
{{Opioidergics}}
Category:4-Phenylpiperidines Category:Synthetic opioids Category:Propionate esters Category:Ethers Category:Mu-opioid receptor agonists
{{analgesic-stub}}