{{Short description|Chemical compound}} {{Drugbox | verifiedrevid = 450105138 | IUPAC_name = 1,2-dimethyl-3-phenylpyrrolidin-3-yl propionate | image = Prodilidine.svg | image_class = skin-invert-image | width = 240
<!--Clinical data--> | tradename = | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =
<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
<!--Identifiers--> | CAS_number_Ref = {{cascite|correct|??}} | CAS_number = 3734-17-6 | ATC_prefix = none | ATC_suffix = | PubChem = 19514 | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank = | UNII_Ref = {{fdacite|correct|FDA}} | UNII = P67JPY18WD | ChemSpiderID = 18388
<!--Chemical data--> | C=15 | H=21 | N=1 | O=2 | smiles = CCC(=O)OC1(CCN(C1C)C)C2=CC=CC=C2 | StdInChI = 1S/C15H21NO2/c1-4-14(17)18-15(10-11-16(3)12(15)2)13-8-6-5-7-9-13/h5-9,12H,4,10-11H2,1-3H3 | StdInChIKey = LUKSBMJXPCFBKO-UHFFFAOYSA-N | synonyms = }}
'''Prodilidine''' is an opioid analgesic which is a ring-contracted analogue of prodine. It has around the same analgesic efficacy as codeine, but is only around 1/3 the potency (100mg prodilidine is equivalent to 3mg oral morphine). It has little abuse potential.<ref>{{cite journal | url = http://www.unodc.org/unodc/en/data-and-analysis/bulletin/bulletin_1964-01-01_1_page005.html | vauthors = Fraser HF | title = Addictiveness of 1,2-dimethyl,3-phenyl,3-propionoxy pyrrolidine hydrochloride (ARC I-O-1) | journal = UNODC Bulletin on Narcotics | date = January 1964 | volume = 16| issue = 1 | pages = 37–43 }}</ref><ref>{{cite journal | vauthors = Splitter SR | title = Treatment of pain in patients with a new nonnarcotic analgesic, prodilidine hydrochloride (Cogesic) | journal = Current Therapeutic Research, Clinical and Experimental | volume = 3 | pages = 472–7 | date = November 1961 | pmid = 13915874 }}</ref><ref>{{cite journal | vauthors = Kissel JW, Albert JR, Boxill GC | title = The pharmacology of prodilidine hydrochloride, a new analgetic agent | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 134 | pages = 332–40 | date = December 1961 | pmid = 14456453 }}</ref><ref>{{cite journal | vauthors = Weikel JH, Labudde JA | title = Absorption, excretion and fate of prodilidine | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 138 | pages = 392–8 | date = December 1962 | pmid = 13999550 }}</ref><ref>{{cite journal | vauthors = Batterman RC, Mouratoff GJ, Kaufman JE | title = Prodilidine Hydrochloride: A new moderately potent analgesic | journal = The American Journal of the Medical Sciences | volume = 247 | pages = 62–8 | date = January 1964 | pmid = 14106881 | doi = 10.1097/00000441-196401000-00009 | s2cid = 41209143 }}</ref>
== See also == * Profadol
== References == {{Reflist}}
{{Opioidergics}}
Category:Opioids Category:Propionate esters Category:Pyrrolidines Category:Mu-opioid receptor agonists
{{analgesic-stub}}