Procysteine

{{Chembox | ImageFile = Procysteine.svg | ImageSize = 110px | ImageAlt = | IUPACName = | OtherNames = 2-oxo-4-thiazolidinecarboxylic acid, OTC |Section1={{Chembox Identifiers | CASNo = 19771-63-2 | CASNo_Comment = R enantiomer | CASNo_Ref = {{Cascite|correct|CAS}} | ChEBI = 125673 | ChEMBL = 442218 | ChemSpiderID = 65323 | DrugBank = DB12224 | EC_number = 606-375-2 | PubChem = 72390 | UNII = X7063P804E | StdInChI=1S/C4H5NO3S/c6-3(7)2-1-9-4(8)5-2/h2H,1H2,(H,5,8)(H,6,7)/t2-/m0/s1 | StdInChIKey = BMLMGCPTLHPWPY-REOHCLBHSA-N | SMILES = C1[C@H](NC(=O)S1)C(=O)O }} |Section2={{Chembox Properties | C = 4|N=1|O=3|S=1|H=5 | MolarMass = | Appearance = white solid | Density = 1.709 g/cm³<ref>{{cite journal |doi=10.1107/S0108270198006416 |title=(4 ''R'' )-(−)-2-Thioxothiazolidine-4-carboxylic Acid (Raphanusamic Acid) |date=1998 |last1=Dobson |first1=A. J. |last2=Gerkin |first2=R. E. |journal=Acta Crystallographica Section C Crystal Structure Communications |volume=54 |issue=11 |pages=1634–1637 |pmid=9857474 |bibcode=1998AcCrC..54.1634D }}</ref> | MeltingPtC =168-170 | MeltingPt_notes = | BoilingPt = | BoilingPt_notes = | Solubility = }} |Section3={{Chembox Hazards | GHS_ref=[https://pubchem.ncbi.nlm.nih.gov/compound/72390#section=Safety-and-Hazards] | GHSPictograms = {{GHS07}} | GHSSignalWord = Warning | HPhrases = {{H-phrases|315|319|335}} | PPhrases = {{P-phrases|261|264|264+265|271|280|302+352|304+340|305+351+338|319|321|332+317|337+317|362+364|403+233|405|501}} | MainHazards = | FlashPt = | AutoignitionPt = }} }} '''Procysteine''' is an organic compound with the formula {{chem2|CH2NHC(O)SCHCO2H}}. It is a colorless solid. The compound is classified as a derivative of the heterocycle 2-oxo-1,3-thiazoline. Such rings are prepared by the action of phosgene (or related dehydration reagents<ref name=Analyt>{{cite journal |doi=10.1016/0003-2697(84)90837-6 |title=Synthesis of l -2-oxothiazolidine-4-carboxylic acid |date=1984 |last1=Boettcher |first1=Brian |last2=Meister |first2=Alton |journal=Analytical Biochemistry |volume=138 |issue=2 |pages=449–450 |pmid=6742422 }}</ref> on 2-aminoethanethiols, in this case cysteine: :{{chem2|HSCH2CH(NH2)CO2H + COCl2 -> CH2NHC(O)SCHCO2H + 2 HCl }} The compound hydrolyzes to cysteine.<ref>{{cite journal |doi=10.1016/S0009-2797(97)00146-4 |title=Glutathione: An overview of biosynthesis and modulation |date=1998 |last1=Anderson |first1=Mary E. |journal=Chemico-Biological Interactions |volume=111-112 |pages=1–14 |pmid=9679538 |bibcode=1998CBI...111....1A }}</ref> The hydrolysis is catalyzed by 5-oxoprolinase.<ref name=Analyt/>

==References== <references />

Category:Thiazolidines Category:Thiocarbamates