| Tradename | Promycin[1] |
|---|---|
| Atc prefix | L01 |
| Cas number | 801-52-5 |
| Drugbank | DB06478 |
| Pubchem | 13116 |
| Chemspiderid | 12565 |
| Unii | H1WK901OA6 |
| Kegg | D05572 |
| Chembl | 521078 |
| Iupac name | [(4S,6S,7R,8S)-11-amino-7-methoxy-5,12-dimethyl-10,13-dioxo-2,5-diazatetracyclo[7.4.0.02,7.04,6]trideca-1(9),11-dien-8-yl]methyl carbamate |
| C | 16 |
| H | 20 |
| N | 4 |
| O | 5 |
| Smiles | CC1=C(C(=O)C2=C(C1=O)N3C[C@H]4[C@@H]([C@@]3([C@@H]2COC(=O)N)OC)N4C)N |
| Stdinchi | 1S/C16H20N4O5/c1-6-10(17)13(22)9-7(5-25-15(18)23)16(24-3)14-8(19(14)2)4-20(16)11(9)12(6)21/h7-8,14H,4-5,17H2,1-3H3,(H2,18,23)/t7-,8+,14+,16-,19?/m1/s1 |
| Stdinchikey | HRHKSTOGXBBQCB-VFWICMBZSA-N |
Porfiromycin is an N-methyl derivative of the antineoplastic antibiotic, mitomycin C, which is isolated from various Streptomyces bacterial species.[2] As an antineoplastic agent, it is under investigation for the treatment of cancer, particularly head and neck cancer.[1]
Porfiromycin works by generating oxygen radicals and alkylating DNA, resulting in interstrand cross-links and single-strand breaks. This inhibits DNA synthesis and leads to the death of cancer cells. It has a higher toxicity towards hypoxic cells, making it an attractive option for cancer treatment.[2]
Porfiromycin can increase the risk of methemoglobinemia when taken with certain medications.[1] It belongs to the class of compounds known as mitomycins, which are characterized by their aziridine ring linked to a 7-amino-6-methyl-cyclohexa[b]pyrrolizine-5,8-dione structure.[1]
References
- ^ "Porfiromycin". Retrieved January 8, 2022.
- ^ "Porfiromycin (Code C763)". Retrieved January 8, 2022.