{{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 449572721 | ImageFile = Plicadin.png | ImageSize = 200px | PIN = 9-Hydroxy-2,2-dimethyl-2''H'',6''H''-([1]benzofuro[2,3-''d''′]benzo[1,2-''b'':3,4-''b''′]dipyran)-6-one | OtherNames = |Section1={{Chembox Identifiers | CASNo_Ref = {{cascite|changed|??}} | CASNo = 137551-37-2 | PubChem = 10980538 | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 9155739 | InChI = 1/C20H14O5/c1-20(2)8-7-12-14(25-20)6-5-13-17(12)24-19(22)16-11-4-3-10(21)9-15(11)23-18(13)16/h3-9,21H,1-2H3 | InChIKey = SPBFWPDNBGDCCJ-UHFFFAOYAA | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C20H14O5/c1-20(2)8-7-12-14(25-20)6-5-13-17(12)24-19(22)16-11-4-3-10(21)9-15(11)23-18(13)16/h3-9,21H,1-2H3 | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = SPBFWPDNBGDCCJ-UHFFFAOYSA-N | SMILES = Oc4cc5oc2c(C(=O)Oc1c3C=CC(C)(C)Oc3ccc12)c5cc4 }} |Section2={{Chembox Properties | Formula = C<sub>20</sub>H<sub>14</sub>O<sub>5</sub> | MolarMass = 334.32 g/mol | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }} '''Plicadin''' is a coumestan found in the herb ''Psoralea plicata''.<ref>{{cite journal | url=https://www.sciencedirect.com/science/article/abs/pii/003194229185151O | doi=10.1016/0031-9422(91)85151-O | title=A benzoquinone and a coumestan from Psoralea plicata | date=1991 | last1=Rasool | first1=Nazli | last2=Qasim Khan | first2=Abdul | last3=Uddin Ahmad | first3=Viqar | last4=Malik | first4=Abdul | journal=Phytochemistry | volume=30 | issue=8 | pages=2800–2803 | bibcode=1991PChem..30.2800R | url-access=subscription }}</ref>
==References== {{reflist}}
Category:Coumestans Category:Hydroxyarenes Category:Heterocyclic compounds with 5 rings
{{aromatic-stub}}