{{Chembox | ImageFile = Pinacyanol chloride.png | ImageSize = | ImageAlt = | IUPACName = (2E)-1-ethyl-2-[(E)-3-(1-ethylquinolin-1-ium-2-yl)prop-2-enylidene]quinoline;chloride | OtherNames = Quinaldine blue |Section1={{Chembox Identifiers | CASNo = 2768-90-3 | PubChem = 6364575 | ChemSpiderID = 4576043 | EC_number = 220-457-1 | ChEMBL = 1974249 | KEGG = D05672 | UNII = 91SZ6DGY86 | SMILES = CC[n+]1c(ccc2c1cccc2)C=CC=C3C=Cc4ccccc4N3CC.[I-] | InChI = 1S/C25H25N2.HI/c1-3-26-22(18-16-20-10-5-7-14-24(20)26)12-9-13-23-19-17-21-11-6-8-15-25(21)27(23)4-2;/h5-19H,3-4H2,1-2H3;1H/q+1;/p-1 | StdInChIKey = QWYZFXLSWMXLDM-UHFFFAOYSA-M }} |Section2={{Chembox Properties | C=25|H=25|N=2|Cl=1 | MolarMass = | Appearance = blue solid | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | GHSPictograms = {{GHS07}} | GHSSignalWord = Warning | HPhrases = {{H-phrases|315|319|335}} | PPhrases = {{P-phrases|261|264|271|280|302+352|304+340|305+351+338|312|321|332+313|337+313|362|403+233|405|501}} | MainHazards = | FlashPt = | AutoignitionPt = }} }}
'''Pinacyanol''' is a cyanine dye. It is an organic cation, typically isolated as the chloride or iodide salts. The blue dye is prepared from 2-methylquinoline by quaternization with ethyl chloride or ethyl iodide. Condensation with formaldehyde results in coupling. Subsequent oxidation of the leuco intermediate gives the dye.<ref>{{Ullmann |doi=10.1002/14356007.a16_487.pub2|title=Methine Dyes and Pigments|year=2008|last1=Berneth|first1=Horst|isbn=978-3527306732}}</ref> Pinacyanol is a prototypical cyanine dye that was widely used as a sensitizer in electrophotography. Its biological properties have also been investigated widely.<ref>{{cite journal |doi=10.1021/cb600362d|title=Inhibition of Angiogenesis by the Antifungal Drug Itraconazole|year=2007|last1=Chong|first1=Curtis R.|last2=Xu|first2=Jing|last3=Lu|first3=Jun|last4=Bhat|first4=Shridhar|last5=Sullivan|first5=David J.|last6=Liu|first6=Jun O.|journal=ACS Chemical Biology|volume=2|issue=4|pages=263–270|pmid=17432820}}</ref> ==References== <references/>
Category:Quinolines Category:Chlorides Category:Cyanine dyes Category:Quaternary ammonium compounds