{{short description|Pharmaceutical drug}} {{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 464210732 | IUPAC_name = | image = Porfimer Sodium.png | image_class = skin-invert-image | width = 300
<!--Clinical data--> | tradename = Photofrin | Drugs.com = {{drugs.com|CDI|porfimer_sodium}} | licence_EU = yes | licence_US = Photofrin | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = C | legal_AU = <!-- Unscheduled / S2 / S4 / S8 --> | legal_UK = <!-- GSL / P / POM / CD --> | legal_US = Rx-only | routes_of_administration = Intravenous
<!--Pharmacokinetic data--> | bioavailability = NA | protein_bound = ~90% | metabolism = | elimination_half-life = 21.5 days (mean) | excretion = Fecal
<!--Identifiers--> | CAS_number_Ref = {{cascite|correct|CAS}} | CAS_number = 87806-31-3 | index2_label = ethyl ether | CAS_number2_Ref = {{cascite|correct|CAS}} | CAS_number2 = 97067-70-4 | UNII2_Ref = {{fdacite|correct|FDA}} | UNII2 = 625J2HS54G | CAS_supplemental = | ATC_prefix = L01 | ATC_suffix = XD01 | ATC_supplemental = | PubChem = 57166 | DrugBank_Ref = {{drugbankcite|changed|drugbank}} | DrugBank = DB00707 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 10482283 | UNII_Ref = {{fdacite|changed|FDA}} | UNII = Y3834SIK5F | ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL = 1201707
<!--Chemical data--> | C=68 | H=74 | N=8 | O=11 | chemical_formula_comment = (for n=0) | molecular_weight = 1179.36 g/mol (for n=0) | smiles = [Na+].CC(O)C1=C(C)C=2C=C5NC(=CC4=NC(=CC=3NC(C=C1N=2)=C(C)C=3CCC(O)=O)C(CCC(O)=O)=C4C)C(C)=C5C(C)OC(C)C6=C(C)C=7C=C%10NC(=CC9=NC(=CC=8NC(C=C6N=7)=C(C)C=8CCC(O)=O)C(CCC(O)=O)=C9C)C(C)=C%10C(C)O | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C68H74N8O11.Na/c1-29-41(13-17-61(79)80)53-28-56-44(16-20-64(85)86)32(4)48(72-56)24-59-68(36(8)52(76-59)25-58-65(37(9)77)33(5)49(73-58)21-45(29)69-53)40(12)87-39(11)67-35(7)50-22-46-30(2)42(14-18-62(81)82)54(70-46)27-55-43(15-19-63(83)84)31(3)47(71-55)23-57-66(38(10)78)34(6)51(74-57)26-60(67)75-50;/h21-28,37-40,71-73,75,77-78H,13-20H2,1-12H3,(H,79,80)(H,81,82)(H,83,84)(H,85,86);/q;+1/b45-21-,46-22-,47-23-,48-24-,49-21-,50-22-,51-26-,52-25-,53-28-,54-27-,55-27-,56-28-,57-23-,58-25-,59-24-,60-26-; | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = CGQHMICGJYKFFJ-ZLJVSRBASA-N }} '''Porfimer sodium''', sold as '''Photofrin''', is a photosensitizer used in photodynamic therapy and radiation therapy and for palliative treatment of obstructing endobronchial non-small cell lung carcinoma and obstructing esophageal cancer.
Porfimer is a mixture of oligomers formed by ether and ester linkages of up to eight porphyrin units.<ref>{{cite web |url=http://www.accessdata.fda.gov/drugsatfda_docs/label/2008/020451s019lbl.pdf |archive-url=https://web.archive.org/web/20121016140123/http://www.accessdata.fda.gov/drugsatfda_docs/label/2008/020451s019lbl.pdf |url-status=dead |archive-date=October 16, 2012 |title=Porfimer injection Prescribing information}}</ref> In practice, a red light source emitting at 630 nm is used to excite the Porfimer oligomers.<ref name="Usuda_2006">{{cite journal | vauthors = Usuda J, Kato H, Okunaka T, Furukawa K, Tsutsui H, Yamada K, Suga Y, Honda H, Nagatsuka Y, Ohira T, Tsuboi M, Hirano T | display-authors = 6 | title = Photodynamic therapy (PDT) for lung cancers | journal = Journal of Thoracic Oncology | volume = 1 | issue = 5 | pages = 489–93 | date = June 2006 | pmid = 17409904 | doi = 10.1016/S1556-0864(15)31616-6 | doi-access = free }}</ref>
Porfimer is Haematoporphyrin Derivative (HpD) (See PDT).
==Approvals and indications== It was approved in Canada in 1993 for the treatment of bladder cancer.<ref name = "Usuda_2006"/> It was approved in Japan in 1994 (for early stage lung cancer?).<ref name = "Usuda_2006"/> It was approved by the U.S. FDA in December 1995 for esophageal cancer, and in 1998, it was approved for the treatment of early non-small cell lung cancer.<ref name = "Usuda_2006"/>
In August 2003 the FDA approved its use for Barrett's esophagus.<ref>{{cite web |url=http://www.accessdata.fda.gov/psn/printer-full.cfm?id=24 |archive-url=https://web.archive.org/web/20101019161253/http://www.accessdata.fda.gov/psn/printer-full.cfm?id=24 |url-status=dead |archive-date=October 19, 2010 |title=FDA Patient Safety News: Show #20, October 2003 |date=October 2003 |access-date=2009-08-17}}</ref>
==References== {{Reflist}}
==External links== *[http://www.epgonline.org/viewdrug.cfm/letter/P/language/LG0001/drugId/DR003068/drugName/PHOTOFRIN Photofrin ] *[http://www.photofrin.com/ Photofrin marketing info ] *[http://www.rxlist.com/cgi/generic/photofrin_ad.htm Side effects of PDT with Photofrin] *[http://www.quasar.ualberta.ca/edse456/apt/vignettes/photofrin.htm History of Photofrin]
{{Chemotherapeutic agents}}
Category:Photosensitizing agents Category:Porphyrins