{{Short description|Chemical compound}} {{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 408545472 | IUPAC_name = (2''S'',5''R'',6''R'')-3,3-dimethyl-7-oxo-6-[(2-phenoxypropanoyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid | image = Phenethicillin.svg | image_class = skin-invert-image
<!--Clinical data--> | tradename = | Drugs.com = {{drugs.com|international|pheneticillin}} | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> | legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | legal_status = | routes_of_administration =
<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
<!--Identifiers--> | CAS_number_Ref = {{cascite|correct|??}} | CAS_number = 147-55-7 | ATC_prefix = J01 | ATC_suffix = CE05 | PubChem = 272833 | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank = | UNII_Ref = {{fdacite|changed|FDA}} | UNII = EFA30X554H | KEGG_Ref = {{keggcite|correct|kegg}} | KEGG = D08350 | ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL = 1614637 | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 240055 <!--Chemical data--> | C=17 | H=20 | N=2 | O=5 | S=1 | smiles = CC(C(=O)N[C@H]1[C@@H]2N(C1=O)[C@H](C(S2)(C)C)C(=O)O)OC3=CC=CC=C3 | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C17H20N2O5S/c1-9(24-10-7-5-4-6-8-10)13(20)18-11-14(21)19-12(16(22)23)17(2,3)25-15(11)19/h4-9,11-12,15H,1-3H3,(H,18,20)(H,22,23)/t9?,11-,12+,15-/m1/s1 | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = NONJJLVGHLVQQM-JHXYUMNGSA-N }} '''Pheneticillin''' (or '''phenethicillin''') is a penicillin. It is not approved by the FDA for use in the United States.
==References== * {{cite book|title=Index Nominum: International Drug Directory|date=Jan 2000|publisher=Swiss Pharmaceutical Society|isbn=978-3887630751|page=816|url=https://books.google.com/books?id=5GpcTQD_L2oC&dq=Phenethicillin&pg=PA816|access-date=20 April 2015}} * {{cite book| vauthors = Dougherty T, Pucci MJ |title=Antibiotic Discovery and Development |url=https://books.google.com/books?id=E6Dv5XsXU-IC&dq=Phenethicillin&pg=PA86 |date=21 Dec 2011 |publisher=Springer|isbn=978-1461413998|page=86|edition=2012|access-date=20 April 2015}}
{{Cell wall disruptive antibiotics}}
Category:Penicillins
{{antibiotic-stub}}