{{chembox | Reference = | Name = Phellodendrine | ImageFile1 = Phellodendrine.png | ImageSize1 = | ImageFile2 = | ImageSize2 = | IUPACName = 2,11-Dihydroxy-3,10-dimethoxyberbin-7α-ium | SystematicName = (7''S'',13a''S'')-2,11-Dihydroxy-3,10-dimethoxy-7-methyl-5,8,13,13a-tetrahydro-6''H''-isoquinolino[3,2-''a'']isoquinolin-7-ium | OtherNames = |Section1={{Chembox Identifiers | InChI = 1/C20H23NO4/c1-21-5-4-12-8-19(24-2)18(23)10-15(12)16(21)6-13-7-17(22)20(25-3)9-14(13)11-21/h7-10,16H,4-6,11H2,1-3H3,(H-,22,23)/p+1/t16-,21-/m0/s1 | InChIKey = RBBVPNQTBKHOEQ-ZJYUTNJKBY | PubChem = 3081405 | CASNo = 6873-13-8 | ChemSpiderID = 2339019 | SMILES = O(c1cc3c(cc1O)C[C@H]4c2c(cc(OC)c(O)c2)CC[N@+]4(C3)C)C }} |Section2={{Chembox Properties | Formula = C<sub>20</sub>H<sub>24</sub>NO<sub>4</sub> | MolarMass = 342.4083 g/mol | Density = | MeltingPtC = 258 | MeltingPt_notes = (as iodide) | BoilingPt = | Solubility = }} }}

'''Phellodendrine''' is an alkaloid isolated originally from ''Phellodendron amurense'' (Rutaceae).<ref name="pmid13911932">{{cite journal |vauthors=SHIMAMOTO K, JUJIHARA M, TORII H |title=[Pharmacological studies on phellodendrine, the quaternary ammonium alkaloid isolated from Phellodendron amurense, a type of Rutaceae.] |language=ja |journal=Nippon Yakurigaku Zasshi. Folia Pharmacologica Japonica |volume=58 |pages=138–49 |date=March 1962 |pmid=13911932 |doi= 10.1254/fpj.58.138|doi-access=free }}</ref><ref name="pmid7700991">{{cite journal |vauthors=Mori H, Fuchigami M, Inoue N, Nagai H, Koda A, Nishioka I, Meguro K |title=Principle of the bark of Phellodendron amurense to suppress the cellular immune response: effect of phellodendrine on cellular and humoral immune responses |journal=Planta Medica |volume=61 |issue=1 |pages=45–9 |date=February 1995 |pmid=7700991 |doi=10.1055/s-2006-957997 }}</ref>

==See also== * Berberine * Jatrorrhizine * Palmatine

==References== {{Reflist}}

Category:Benzylisoquinoline alkaloids Category:Quaternary ammonium compounds Category:Phenol ethers Category:Isoquinolinoisoquinolines Category:Hydroxyarenes Category:Methoxy compounds

{{alkaloid-stub}}