{{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 440126745 | Name = Pallidol | ImageFile = Pallidol.svg | ImageSize = 200px | ImageName = Chemical structure of pallidol | ImageAlt = Chemical structure of pallidol | PIN = (4b''R'',5''R'',9b''R'',10''R'')-5,10-Bis(4-hydroxyphenyl)-4b,5,9b,10-tetrahydroindeno[2,1-''a'']indene-1,3,6,8-tetrol | OtherNames = <!-- <br> --> |Section1={{Chembox Identifiers | CASNo = 105037-88-5 | CASNo_Ref = {{cascite|correct|??}} | ChemSpiderID = 425065 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = QE5TL72TJ8 | PubChem = 484757 | ChEBI_Ref = {{ebicite|changed|EBI}} | ChEBI = 76173 | SMILES = C1=CC(=CC=C1C2C3C(C(C4=C(C=C(C=C34)O)O)C5=CC=C(C=C5)O)C6=CC(=CC(=C26)O)O)O | StdInChI = 1S/C28H22O6/c29-15-5-1-13(2-6-15)23-25-19(9-17(31)11-21(25)33)28-24(14-3-7-16(30)8-4-14)26-20(27(23)28)10-18(32)12-22(26)34/h1-12,23-24,27-34H/t23-,24-,27+,28+/m1/s1 | StdInChIKey = YNVJOQCPHWKWSO-ZBVBGGFBSA-N | MeSHName = }} |Section2={{Chembox Properties | Formula = C<sub>28</sub>H<sub>22</sub>O<sub>6</sub> | MolarMass = 454.47 g/mol | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = | GHS_ref =<!-- no GHS data in PubChem Dec2021 -->}} }} '''Pallidol''' is a resveratrol dimer. It can be found in red wine,<ref>Pallidol, a resveratrol dimer from red wine, is a selective singlet oxygen quencher. Shan He, Liyan Jiang, Bin Wu, Yuanjiang Pan and Cuirong Sun, Biochemical and Biophysical Research Communications, Volume 379, Issue 2, 6 February 2009, Pages 283-287, {{doi|10.1016/j.bbrc.2008.12.039}}</ref> in ''Cissus pallida''<ref>Pallidol, a resveratrol dimer from Cissus pallida. Mushtaq A. Khan, Shah G. Nabi, Satya Prakash and Asif Zaman, Phytochemistry, Volume 25, Issue 8, 17 July 1986, Pages 1945-1948, {{doi|10.1016/S0031-9422(00)81180-2}}</ref> or in ''Parthenocissus laetevirens''.<ref>Characterization of polyphenol compounds from the roots and stems of Parthenocissus laetevirens by high-performance liquid chromatography/tandem mass spectrometry. Juanjuan Chen, Shan He, Hui Mao, Cuirong Sun and Yuanjiang Pan, Rapid Commun. Mass Spectrom. 2009, 23, pp. 737–744, {{doi|10.1002/rcm}}</ref>

<!-- ==Metabolism== -->

== References == {{reflist}}

== External links == * [http://www.phenol-explorer.eu/compounds/588 Pallidol on www.phenol-explorer.eu]

{{Oligostilbenoid}}

Category:Resveratrol oligomers Category:Stilbenoid dimers Category:Wine chemistry Category:Tetracyclic compounds Category:Hexols Category:Indanes

{{aromatic-stub}}