{{Short description|Triple reuptake inhibitor investigated by the Mayo Clinic}} {{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 451223794 | IUPAC_name = (1''S'',2''S'')-3-(Methylamino)-2-naphthalen-2-yl-1-phenylpropan-1-ol | image = PRC200 structure.png | image_class = skin-invert-image
<!--Clinical data--> | tradename = | pregnancy_category = | legal_status = | routes_of_administration =
<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
<!--Identifiers--> | CAS_number_Ref = {{cascite|correct|CAS}} | CAS_number = 492434-58-9 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = V9MLT2S334 | ATC_prefix = | ATC_suffix = | ATC_supplemental = | PubChem = 20631904 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 19318181
<!--Chemical data--> | C=20 | H=21 | N=1 | O=1 | smiles = O[C@H](c1ccccc1)[C@H](CNC)c2cc3ccccc3cc2 | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C20H21NO/c1-21-14-19(20(22)16-8-3-2-4-9-16)18-12-11-15-7-5-6-10-17(15)13-18/h2-13,19-22H,14H2,1H3/t19-,20-/m1/s1 | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = RSZGIFQDUIROGN-WOJBJXKFSA-N }}
'''PRC200-SS''' is an experimental drug of the triple reuptake inhibitor class that was investigated by the Mayo Clinic.<ref name=Liang>{{cite journal | vauthors = Liang Y, Shaw AM, Boules M, Briody S, Robinson J, Oliveros A, Blazar E, Williams K, Zhang Y, Carlier PR, Richelson E | display-authors = 6 | title = Antidepressant-like pharmacological profile of a novel triple reuptake inhibitor, (1S,2S)-3-(methylamino)-2-(naphthalen-2-yl)-1-phenylpropan-1-ol (PRC200-SS) | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 327 | issue = 2 | pages = 573–83 | date = November 2008 | pmid = 18689611 | doi = 10.1124/jpet.108.143610 | s2cid = 12635418 }}</ref><ref>{{Cite web | url = http://technologies.ventures.mayoclinic.org/technologies/2011-044_triple-reuptake-inhibitors-for-the-treatment-of-depression | title = Triple Reuptake Inhibitors for the Treatment of Depression | publisher = Mayo Clinic Ventures }}</ref>
Preclinical toxicology studies of PRC200-SS in cynomolgus monkeys showed dose proportional kidney toxicity,<ref name="pmid21258088">{{cite journal | vauthors = Guha M, Heier A, Price S, Bielenstein M, Caccese RG, Heathcote DI, Simpson TR, Stong DB, Bodes E | display-authors = 6 | title = Assessment of biomarkers of drug-induced kidney injury in cynomolgus monkeys treated with a triple reuptake inhibitor | journal = Toxicological Sciences | volume = 120 | issue = 2 | pages = 269–83 | date = April 2011 | pmid = 21258088 | doi = 10.1093/toxsci/kfr013 | doi-access = free }}</ref> precluding any further drug development.
== References == {{Reflist}}
{{Antidepressants}} {{Monoamine reuptake inhibitors}}
Category:Abandoned drugs Category:Secondary amines Category:2-Naphthyl compounds Category:Naphthylethylamines Category:Secondary alcohols Category:Serotonin–norepinephrine–dopamine reuptake inhibitors