{{Short description|Chemical compound}} {{DISPLAYTITLE:Prostaglandin G<sub>2</sub>}} {{Chembox | Name = Prostaglandin G<sub>2</sub> | ImageFile = Prostaglandin G2.svg | ImageSize = | IUPACName = (5''Z'')-7-{(1''R'',4''S'',5''R'',6''R'')-6-[(1''E'',3''S'')-3-Hydroperoxy-1-octen-1-yl]-2,3-dioxabicyclo[2.2.1]hept-5-yl}-5-heptenoic acid | OtherNames = | Section1 = {{Chembox Identifiers | CASNo = 51982-36-6 | CASNo_Ref = {{cascite|correct|CAS}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = AZ87DUD2Y8 | PubChem = 5280883 | ChemSpiderID = 4444406 | EINECS = 200-662-2 | ChEBI = 27647 | KEGG = C05956 | SMILES = CCCCC[C@@H](/C=C/[C@H]1[C@H]2C[C@@H]([C@@H]1C/C=C\CCCC(=O)O)OO2)OO | InChI = 1/C20H32O6/c1-2-3-6-9-15(24-23)12-13-17-16(18-14-19(17)26-25-18)10-7-4-5-8-11-20(21)22/h4,7,12-13,15-19,23H,2-3,5-6,8-11,14H2,1H3,(H,21,22)/b7-4-,13-12+/t15-,16+,17+,18-,19+/m0/s1 | InChIKey = SGUKUZOVHSFKPH-YNNPMVKQBO | StdInChI = 1S/C20H32O6/c1-2-3-6-9-15(24-23)12-13-17-16(18-14-19(17)26-25-18)10-7-4-5-8-11-20(21)22/h4,7,12-13,15-19,23H,2-3,5-6,8-11,14H2,1H3,(H,21,22)/b7-4-,13-12+/t15-,16+,17+,18-,19+/m0/s1 | StdInChIKey = SGUKUZOVHSFKPH-YNNPMVKQSA-N }} | Section2 = {{Chembox Properties | C=20 | H=32 | O=6 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} | Section3 = {{Chembox Hazards | MainHazards = | FlashPt = | Autoignition = }} }}
'''Prostaglandin G<sub>2</sub>''' ('''PGG<sub>2</sub>''') is an organic peroxide belonging to the family of prostaglandins.<ref name=vvd>{{cite journal|title=The cyclooxygenase reaction mechanism|author1=Wilfred van der Donk|author2= Tsai Ah-Lim|author3=Kulmacz Richard J.|journal=Biochemistry|year=2002|volume=41|issue=52|pages=15451–8|doi=10.1021/bi026938h|pmid=12501173}}</ref> The compound has been isolated as a solid, although it is usually used in vivo. It quickly converts into prostaglandin H<sub>2</sub>, a process catalyzed by the enzyme cyclooxygenase (COX).
Prostaglandin G<sub>2</sub> is produced from the fatty acid arachidonic acid. The reaction, a double oxygenation, requires the enzyme COX, which inserts two molecules of O<sub>2</sub> into the C-H bonds of the substrate acid.<ref name=Marnett>{{cite journal |doi=10.1021/cr000068x |title=Mechanism of Free Radical Oxygenation of Polyunsaturated Fatty Acids by Cyclooxygenases |date=2003 |last1=Rouzer |first1=Carol A. |last2=Marnett |first2=Lawrence J. |journal=Chemical Reviews |volume=103 |issue=6 |pages=2239–2304 |pmid=12797830 }}</ref><ref name=vvd/><ref>{{cite web|url=https://www.scbt.com/scbt/product/prostaglandin-g2-51982-36-6|title=Prostaglandin G2|publisher=Santa cruz biotechnology, inc|access-date=27 April 2015}}</ref>
==References== {{Reflist}}
{{Prostanoid signaling modulators}} {{Aryl hydrocarbon receptor modulators}}
Category:Prostaglandins
{{organic-compound-stub}}