{{cs1 config|name-list-style=vanc|display-authors=6}} {{Drugbox | IUPAC_name = 3-[9-methoxy-3-(2-phenylethyl)-3-azabicyclo[3.3.1]nonan-9-yl]phenol | image = P-7521_structure.png | image_class = skin-invert-image | width = 200

<!--Clinical data--> | tradename = | pregnancy_category = | legal_US = | routes_of_administration =

<!--Pharmacokinetic data--> | bioavailability = | metabolism = | excretion =

<!--Identifiers--> | ATC_suffix = | CAS_number = 92836-37-8 | UNII = | PubChem = 146384 | ChemSpiderID = 129116

<!--Chemical data--> | C=23 | H=29 | N=1 | O=2 | smiles = COC1(C2CCCC1CN(C2)CCC3=CC=CC=C3)C4=CC(=CC=C4)O | StdInChI = 1S/C23H29NO2/c1-26-23(19-9-6-12-22(25)15-19)20-10-5-11-21(23)17-24(16-20)14-13-18-7-3-2-4-8-18/h2-4,6-9,12,15,20-21,25H,5,10-11,13-14,16-17H2,1H3 | StdInChIKey = UXFOUDJIDGKJDT-UHFFFAOYSA-N }}

'''P-7521''' is an opioid analgesic drug developed in China in the 1980s.<ref>{{cite journal | vauthors = Zhou J, Zheng WJ, Chi ZQ | title = [Analgesic activity and respiratory inhibition of 3-beta-phenylethyl)-9 beta-methoxy-9 alpha-(m-hydroxyphenyl)-3-azabicyclo [3,3,1]-nonane (P-7521) in rabbits] | journal = Zhongguo Yao Li Xue Bao = Acta Pharmacologica Sinica | volume = 8 | issue = 1 | pages = 10–13 | date = January 1987 | pmid = 2955652 }}</ref><ref>{{cite journal | vauthors = Zhou DH, Ge BL, Xu XJ, Chi ZQ | title = [Effects of the long-acting analgesics 3-(beta-phenylethyl)-9 beta-methoxy-9 alpha-(m-hydroxyphenyl)-3-azabicycles [3,3,1]-nonane (P-7521) on opiate receptor binding in vitro] | journal = Zhongguo Yao Li Xue Bao = Acta Pharmacologica Sinica | volume = 9 | issue = 6 | pages = 511–515 | date = November 1988 | pmid = 2855686 }}</ref><ref>{{cite journal | vauthors = Jin WQ, Fan LQ, Chen XJ, Chi ZQ | title = P-7521--a new irreversible opioid ligand | journal = Zhongguo Yao Li Xue Bao = Acta Pharmacologica Sinica | volume = 10 | issue = 3 | pages = 205–210 | date = May 1989 | pmid = 2558497 }}</ref><ref>{{cite journal | vauthors = Chi ZQ, Jin WQ | title = A potent and long-lasting ligand, azabicyclononane (P-7521) | journal = Progress in Clinical and Biological Research | date = 1990 | volume = 328 | pages = 1–4 | pmid = 2154758 }}</ref>

== See also == * Anazocine * Phenazocine

== References == {{Reflist}}

{{Opioidergics}}

Category:Synthetic opioids Category:Mu-opioid receptor agonists Category:3-Hydroxyphenyl compounds Category:Methoxy compounds Category:Phenethylamines Category:Azocines

{{analgesic-stub}}