{{Short description|Chemical compound}} {{Drugbox | Verifiedfields = | Watchedfields = | verifiedrevid = | IUPAC_name = 3-<nowiki/>{[(1''S'',2''R'',9''R'',10''R'',11''S'',15''S'')-2,15-Dimethyl-5,14-dioxotetracyclo[8.7.0.0<sup>2,7</sup>.0<sup>11,15</sup>]heptadec-6-en-9-yl]sulfanyl}propanoic acid | image = Ovandrotone.svg | image_class = skin-invert-image | width = 250
<!--Clinical data--> | tradename = | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =
<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
<!-- Identifiers --> | CAS_number_Ref = | CAS_number = 40845-00-9 | CAS_supplemental = | ATC_prefix = | ATC_suffix = | ATC_supplemental = | PubChem = 20538550 | IUPHAR_ligand = | DrugBank_Ref = | DrugBank = | ChemSpiderID = 59650713 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 5AJ49935NF | KEGG = | ChEBI = | ChEMBL =
<!--Chemical data--> | C=22 | H=30 | O=4 | S=1 | SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)[C@@H](CC1=CC(=O)CC[C@]31C)SCCC(O)=O | StdInChI_Ref = | StdInChI = 1S/C22H30O4S/c1-21-8-5-14(23)11-13(21)12-17(27-10-7-19(25)26)20-15-3-4-18(24)22(15,2)9-6-16(20)21/h11,15-17,20H,3-10,12H2,1-2H3,(H,25,26)/t15-,16-,17+,20-,21?,22?/m0/s1 | StdInChIKey_Ref = | StdInChIKey = OZLABWUNIWIISO-DHEJPUEPSA-N | synonyms = Androstenedione-7α-carboxyethylthioether; 3-[(3,17-Dioxoandrost-4-en-7α-yl)thio]propanoic acid }}
'''Ovandrotone''', also known as '''androstenedione-7α-carboxyethylthioether''',<ref name="ASAS1991">{{cite book|title=Journal of Animal Science|url=https://books.google.com/books?id=nbqzAAAAIAAJ|year=1991|publisher=American Society of Animal Science|pages=3931–3932}}</ref> is a synthetic androstane steroid and the C7α carboxyethylthioether of androstenedione.<ref name="Elks2014">{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=RA1-PA908|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|page=908}}</ref> It is a component of ovandrotone albumin (Fecundin), a conjugate of androstenedione and human serum albumin and an immunogen and vaccine against androstenedione that is used to generate androgen immunity and thereby increase the ovulation rate and number of lambs born to ewes.<ref name="HoskinsonScaramuzzi1986">{{cite book| vauthors = Hoskinson RM, Scaramuzzi RJ, Campbell BK, Downing JA, Welch RJ, Harrison BE |title=Immunological Approaches to Contraception and Promotion of Fertility|chapter=Effects of Antibodies to Steroid Hormones on Reproductive Events of Sheep and Cattle|series=Reproductive Biology |year=1986|pages=351–366|publisher=Springer |doi=10.1007/978-1-4684-5140-5_38|isbn=978-1-4684-5142-9}}</ref><ref name="Carnegie1988">{{cite book| vauthors = Carnegie PR |title=Anti-Idiotypes, Receptors, and Molecular Mimicry|chapter=Autoimmunization Against Hormones: A New Strategy in Animal Production|year=1988|pages=245–254|publisher=Springer |doi=10.1007/978-1-4612-3734-1_15|isbn=978-1-4612-8325-6}}</ref>
== References == {{Reflist|2}}
Category:Androstanes Category:Diketones Category:Thioethers Category:Veterinary drugs Category:Sheep
{{steroid-stub}} {{genito-urinary-drug-stub}}