{{Chembox | ImageFile = Orchinol.svg | ImageAlt = Chemical structure of orchinol | PIN = 5,7-Dimethoxy-9,10-dihydrophenanthren-2-ol | OtherNames = 9,10-Dihydro-5,7-dimethoxyphenanthren-2-ol |Section1={{Chembox Identifiers | CASNo = 41060-20-2 | CASNo_Ref = {{cascite|correct|CAS}} | UNII_Ref = {{fdacite|correct|FDA}} | UNII = V897GN013Q | PubChem = 181686 | SMILES = COC1=CC(=C2C(=C1)CCC3=C2C=CC(=C3)O)OC | ChemSpiderID = 158032 | InChI = 1/C16H16O3/c1-18-13-8-11-4-3-10-7-12(17)5-6-14(10)16(11)15(9-13)19-2/h5-9,17H,3-4H2,1-2H3 | InChIKey = HOVUVTNDNLNINP-UHFFFAOYAM | StdInChI = 1S/C16H16O3/c1-18-13-8-11-4-3-10-7-12(17)5-6-14(10)16(11)15(9-13)19-2/h5-9,17H,3-4H2,1-2H3 | StdInChIKey = HOVUVTNDNLNINP-UHFFFAOYSA-N }} |Section2={{Chembox Properties | C = 16 | H = 16 | O = 3 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }} '''Orchinol''' is a 9,10-dihydrophenanthrene, a type of phenanthrenoid. It can be isolated from infected ''Orchis militaris'' and infected ''Loroglossum hircinum''<ref>Structure of Orchinol, Loroglossol, and Hircinol. Roy M. Letcher and Llewellyn R. M. Nhamo, J. Chem. Soc., Perkin Trans. 1, 1973, pages 1263-1265, {{doi|10.1039/P19730001263}}</ref> with ''Rhizoctonia repens''.<ref>Orchinol. Richard Braun, Moderne Methoden der Pflanzenanalyse, 1963, Volume 6, pages 130-134, {{doi|10.1007/978-3-642-94878-7_7}} (article in German)</ref> This molecule has a phytoalexin effect. It reduces the growth of ''Cattleya aurantiaca'' seedlings<ref>Effects of Orchinol, Loroglossol, Dehydroorchinol, Batatasin III, and 3,4'- Dihydroxy-5-Methoxydihydrostilbene on Orchid Seedlings. Katherine A. Hills, Albert Stoessl, Allison P. Oliva and Joseph Arditti, Botanical Gazette, September 1984, Vol. 145, No. 3, pages 298-301 ([https://www.jstor.org/stable/2474721 link])</ref> and has an antifungal activity.<ref>Structure and antifungal activity of hircinol, loroglossol and orchinol. M.H. Fisch, Brigitta H. Flick and J. Arditti, Phytochemistry, February 1973, Volume 12, Issue 2, Pages 437–441, {{doi|10.1016/0031-9422(73)80036-6}}</ref>
== References == {{reflist}}
== External links == * [http://kanaya.naist.jp/knapsack_jsp/information.jsp?word=C00002892 Orchinol at kanaya.naist.jp/knapsack_jsp] * [http://www.wikigenes.org/e/chem/e/181686.html Orchinol at WikiGenes]
{{Phenanthrenes}}
Category:Phenanthrenoids
{{aromatic-stub}}