{{Short description|Chemical compound}} {{Drugbox | Verifiedfields = | Watchedfields = | verifiedrevid = | IUPAC_name = (2''R'')-''N''<nowiki>'</nowiki>-[5-[3-(2,5-difluorophenyl)-2-(1,3-dihydrobenzimidazol-2-ylidene)-3-oxopropanoyl]-2-fluorophenyl]sulfonyl-2-hydroxypropanimidamide | image = Opigolix.svg | image_class = skin-invert-image | width = 250px

<!--Clinical data--> | tradename = | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration = By mouth | class = GnRH modulator; GnRH antagonist; Antigonadotropin

<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

<!-- Identifiers --> | CAS_number_Ref = {{cascite|correct|CAS}} | CAS_number = 912587-25-8 | CAS_supplemental = | ATC_prefix = | ATC_suffix = | ATC_supplemental = | PubChem = 11977994 | IUPHAR_ligand = | DrugBank_Ref = | DrugBank = | ChemSpiderID_Ref = | ChemSpiderID = | UNII = VQ6CK0CITA | KEGG = D11351 | ChEBI = | ChEMBL = | synonyms = ASP-1707

<!--Chemical data--> | C=25 | H=19 | F=3 | N=4 | O=5 | S=1 | SMILES = C[C@@H](O)/C(N)=N/S(=O)(=O)c1cc(C(=O)C(C(=O)c2cc(F)ccc2F)=C2Nc3ccccc3N2)ccc1F | StdInChI_Ref = | StdInChI = 1S/C25H19F3N4O5S/c1-12(33)24(29)32-38(36,37)20-10-13(6-8-17(20)28)22(34)21(23(35)15-11-14(26)7-9-16(15)27)25-30-18-4-2-3-5-19(18)31-25/h2-12,30-31,33H,1H3,(H2,29,32)/t12-/m1/s1 | StdInChIKey_Ref = | StdInChIKey = CWNLBPBIFALUQD-GFCCVEGCSA-N }}

'''Opigolix''' ({{abbrlink|INN|International Nonproprietary Name}}, {{abbrlink|USAN|United States Adopted Name}}; developmental code name '''ASP-1707''') is a small-molecule, non-peptide, orally active gonadotropin-releasing hormone antagonist (GnRH antagonist) which was under development by Astellas Pharma for the treatment of endometriosis and rheumatoid arthritis.<ref name="AdisInsight">{{Cite web |title=Opigolix - Astellas Pharma - AdisInsight |url=https://adisinsight.springer.com/drugs/800032657}}</ref><ref name="pmid25581052">{{Cite journal |vauthors=Ezzati M, Carr BR |year=2015 |title=Elagolix, a novel, orally bioavailable GnRH antagonist under investigation for the treatment of endometriosis-related pain |journal=Women's Health |volume=11 |issue=1 |pages=19–28 |doi=10.2217/whe.14.68 |pmid=25581052 |doi-access=free}}</ref> It was also under investigation for the treatment of prostate cancer.<ref name="AdisInsight" /> It reached phase II clinical trials for both endometriosis and rheumatoid arthritis prior to the discontinuation of its development in April 2018.<ref name="AdisInsight" />

==See also== * Gonadotropin-releasing hormone receptor § Antagonists

==References== {{Reflist}}

==External links== * [https://adisinsight.springer.com/drugs/800032657 Opigolix - AdisInsight]

{{GnRH and gonadotropins}} {{GnRH and gonadotropin receptor modulators}}

Category:Abandoned drugs Category:Secondary alcohols Category:Amidines Category:Benzimidazoles Category:Fluoroarenes Category:Gonadotropin-releasing hormone antagonists Category:Aromatic ketones

{{Genito-urinary-drug-stub}}