{{About|the "Nudol phenanthrenoid |the anti-ballistic missile system|Nudol (missile)}}{{For|the missile|A-235 anti-ballistic missile system}}{{Chembox | ImageFile = Nudol.svg | ImageSize = 250px | ImageAlt = Chemical structure of nudol | PIN = 3,4-Dimethoxyphenanthrene-2,7-diol | OtherNames = 2,7-dihydroxy-3,4-dimethoxyphenanthrene |Section1={{Chembox Identifiers | CASNo = 86630-46-8 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = YB2NXM248V | PubChem = 158975 | SMILES = COC1=C(C=C2C=CC3=C(C2=C1OC)C=CC(=C3)O)O | ChemSpiderID = 139835 | InChI = 1/C16H14O4/c1-19-15-13(18)8-10-4-3-9-7-11(17)5-6-12(9)14(10)16(15)20-2/h3-8,17-18H,1-2H3 | InChIKey = JZIYNZGPIKGKQC-UHFFFAOYAW | StdInChI = 1S/C16H14O4/c1-19-15-13(18)8-10-4-3-9-7-11(17)5-6-12(9)14(10)16(15)20-2/h3-8,17-18H,1-2H3 | StdInChIKey = JZIYNZGPIKGKQC-UHFFFAOYSA-N }} |Section2={{Chembox Properties | Formula = C<sub>16</sub>H<sub>14</sub>O<sub>4</sub> | MolarMass = 270.28 g/mol | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }} '''Nudol''' is a phenanthrenoid of the orchids ''Eulophia nuda'', ''Eria carinata'', ''Eria stricta''<ref>Nudol, a phenanthrene of the orchids Eulophia nuda, Eria carinata and Eria stricta. S Bhandari, Phytochemistry, January 1985, volume 24, issue 4, pages 801-804, {{doi|10.1016/S0031-9422(00)84898-0}}</ref> and ''Maxillaria densa''.<ref>New Phenanthrene Derivatives from Maxillaria densa. Samuel Estrada, Rubén A. Toscanoand Rachel Mata, J. Nat. Prod., 1999, volume 62, issue 8, pages 1175–1178, {{doi|10.1021/np990061e}}</ref>

== References == {{reflist}}

{{Phenanthrenes}}

Category:Phenanthrenoids

{{aromatic-stub}}