Nothofagin

{{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 451950115 | ImageFile = Nothofagin structure.svg | ImageSize = 200px | IUPACName = 2',4,4',6'-Tetrahydroxy-3-C-β-<small>D</small>-glucopyranosyldihydrochalcone | OtherNames = |Section1={{Chembox Identifiers | CASNo_Ref = {{cascite|correct|??}} | CASNo = 11023-94-2 | PubChem = 21722188 | ChEMBL = 4082869 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 10306387 | SMILES = O[C@H]1[C@H](O)[C@@H](O)[C@@H](O[C@@H]1CO)c3c(O)cc(O)c(C(=O)CCc2ccc(O)cc2)c3O | InChI = 1/C21H24O10/c22-8-14-17(27)19(29)20(30)21(31-14)16-13(26)7-12(25)15(18(16)28)11(24)6-3-9-1-4-10(23)5-2-9/h1-2,4-5,7,14,17,19-23,25-30H,3,6,8H2/t14-,17-,19+,20-,21+/m1/s1 | InChIKey = VZBPTZZTCBNBOZ-VJXVFPJBBW | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C21H24O10/c22-8-14-17(27)19(29)20(30)21(31-14)16-13(26)7-12(25)15(18(16)28)11(24)6-3-9-1-4-10(23)5-2-9/h1-2,4-5,7,14,17,19-23,25-30H,3,6,8H2/t14-,17-,19+,20-,21+/m1/s1 | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = VZBPTZZTCBNBOZ-VJXVFPJBSA-N

}} |Section2={{Chembox Properties | C=21 | H=24 | O=10 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}

'''Nothofagin''' is a dihydrochalcone. It is a ''C''-linked phloretin glucoside found in rooibos (''Aspalathus linearis'')<ref>{{cite journal |vauthors=Bramati L, etal | title = Quantitative Characterization of Flavonoid Compounds in Rooibos Tea (''Aspalathus Linearis'') by LC-UV/DAD | journal = Journal of Agricultural and Food Chemistry | volume = 50 | pages = 5513–5519 | publisher = Elsevier | year = 2002 | doi = 10.1021/jf025697h | pmid = 12236672 | issue = 20}}</ref> and New Zealand red beech (''Nothofagus fusca'').<ref>{{cite journal | vauthors = Hillis W, Inoue T | title = The polyphenols of ''Nothofagus'' species - II. The heartwood of ''Nothofagus fusca'' | journal = Phytochemistry | volume = 6 | pages = 59–67 | year = 1967 | issue = 1 | doi = 10.1016/0031-9422(67)85008-8| bibcode = 1967PChem...6...59H }}</ref> It is a phenolic antioxidant.

==References== <references />

==External links== *{{Commonscat-inline}}

Category:Dihydrochalcone glycosides Category:Glucosides Category:Polyphenols