{{Chembox <!-- Images --> | ImageFile = Nitensidine_D.svg | ImageSize = 200px <!-- Names --> | IUPACName = (E)-2-(3,7-dimethylocta-2,6-dien-1-yl)guanidine | OtherNames = {{ubl|geranyl guanidine}} <!-- Sections --> | Section1 = {{Chembox Identifiers | CASNo = 1107631-55-9 | CASNo_Ref = {{Cascite|changed|??}}<ref>{{cite web |title=KNApSAcK Metabolite Information - C00047317 |url=http://www.knapsackfamily.com/knapsack_core/information.php?sname=C_ID&word=C00047317 |website=www.knapsackfamily.com}}</ref> | PubChem = 45269644 | ChemSpiderID = 24623230 | ChEBI = | ChEMBL = 556739 | KEGG = | SMILES = CC(=CCC/C(=C/CN=C(N)N)/C)C | StdInChI=1S/C11H21N3/c1-9(2)5-4-6-10(3)7-8-14-11(12)13/h5,7H,4,6,8H2,1-3H3,(H4,12,13,14)/b10-7+ | StdInChIKey = WDTUVHUDPPUQMN-JXMROGBWSA-N }} | Section2 = {{Chembox Properties | C=11|H=21|N=3 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} | Section3 = {{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}
'''Nitensidine D''' is a toxic alkaloid natural product that was isolated from the leaves of the South American legume ''Pterogyne nitens''.<ref name="Regasini Castro-Gamboa Silva Furlan pp. 473–476">{{cite journal | last1=Regasini | first1=Luis Octávio | last2=Castro-Gamboa | first2=Ian | last3=Silva | first3=Dulce Helena Siqueira | last4=Furlan | first4=Maysa | last5=Barreiro | first5=Eliezer Jesus | last6=Ferreira | first6=Paulo Michel Pinheiro | last7=Pessoa | first7=Cláudia | last8=Lotufo | first8=Letícia Veras Costa | last9=de Moraes | first9=Manoel Odorico | last10=Young | first10=Maria Claudia Marx | last11=Bolzani | first11=Vanderlan da Silva | title=Cytotoxic Guanidine Alkaloids fromPterogyne nitens△ | journal=Journal of Natural Products | publisher=American Chemical Society (ACS) | volume=72 | issue=3 | date=2009-03-27 | issn=0163-3864 | doi=10.1021/np800612x | pages=473–476| pmid=19159272 | bibcode=2009JNAtP..72..473R }}</ref> It is also hypothesized to be a possible intermediate in the still unknown, seemingly monoterpene based, terrestrial biosynthetic pathway for tetrodotoxin.<ref name="Kudo Yotsu-Yamashita pp. 1656–1663">{{cite journal | last1=Kudo | first1=Yuta | last2=Yotsu-Yamashita | first2=Mari | title=Isolation and Biological Activity of 8-Epitetrodotoxin and the Structure of a Possible Biosynthetic Shunt Product of Tetrodotoxin, Cep-226A, from the Newt Cynops ensicauda popei | journal=Journal of Natural Products | publisher=American Chemical Society (ACS) | volume=82 | issue=6 | date=2019-05-22 | issn=0163-3864 | doi=10.1021/acs.jnatprod.9b00178 | pages=1656–1663| pmid=31117524 | bibcode=2019JNAtP..82.1656K | s2cid=162180379 }}</ref>
==See also== * Galegine ==References== {{reflist}}
Category:Guanidine alkaloids Category:Plant toxins
{{alkaloid-stub}}