{{cs1 config|name-list-style=vanc|display-authors=6}} {{Drugbox | IUPAC_name = 1-pyrimidin-5-yl-9H-pyrido[3,4-b]indol-6-ol | image = NU-1223.svg | image_class = skin-invert-image | width = 250px

<!--Clinical data--> | tradename = | pregnancy_category = | legal_status = | routes_of_administration =

<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

<!--Identifiers--> | CAS_number = 2415092-49-6 | ATC_prefix = | ATC_suffix = | ChEMBL = | PubChem = 146464666 | ChemSpiderID =

<!--Chemical data--> | C=15 | H=10 | N=4 | O=1 | smiles = C1=CC2=C(C=C1O)C3=C(N2)C(=NC=C3)C4=CN=CN=C4 | StdInChI = 1S/C15H10N4O/c20-10-1-2-13-12(5-10)11-3-4-18-14(15(11)19-13)9-6-16-8-17-7-9/h1-8,19-20H | StdInChIKey = QIMOFNWSIPJEKQ-UHFFFAOYSA-N }}

'''NU-1223''' is an experimental drug from the β-carboline family, which is thought to act as a selective agonist of the 5-HT<sub>2C</sub> receptor. It has been investigated for possible applications in the treatment of schizophrenia.<ref name="Rajagopal_2023">{{cite journal | vauthors = Rajagopal L, Mahjour S, Huang M, Ryan CA, Elzokaky A, Csakai AJ, Orr MJ, Scheidt K, Meltzer HY | title = NU-1223, a simplified analog of alstonine, with 5-HT2cR agonist-like activity, rescues memory deficit and positive and negative symptoms in subchronic phencyclidine mouse model of schizophrenia | journal = Behavioural Brain Research | volume = 454 | article-number = 114614 | date = October 2023 | pmid = 37572758 | doi = 10.1016/j.bbr.2023.114614 | doi-access = free }}</ref>

==See also== * Substituted β-carboline * Alstonine * Harmine * LY-266,097 * LY-272,015 * Fenharmane * 1-(2,4,5-Trimethoxyphenyl)-6-chlorotryptoline

==References== {{Reflist}}

{{Serotonin receptor modulators}} {{Tryptamines}}

Category:Beta-Carbolines Category:Pyrimidines Category:Serotonin receptor agonists Category:Hydroxyarenes

{{nervous-system-drug-stub}}