{{DISPLAYTITLE:''N''-Acetyldopamine}} {{Chembox | Name = ''N''-Acetyldopamine | ImageFile = NADAstructure.svg | ImageClass = skin-invert-image | ImageSize = 120 | ImageAlt = | IUPACName = | OtherNames = |Section1={{Chembox Identifiers | CASNo = 2494-12-4 | CASNo_Ref = {{Cascite|correct|CAS}} | ChEBI = 125678 | ChEMBL = 137743 | ChemSpiderID = 90825 | PubChem = 100526 | StdInChI=1S/C10H13NO3/c1-7(12)11-5-4-8-2-3-9(13)10(14)6-8/h2-3,6,13-14H,4-5H2,1H3,(H,11,12) | StdInChIKey = OFSAJYZMIPNPHE-UHFFFAOYSA-N | SMILES = CC(=O)NCCC1=CC(=C(C=C1)O)O }} |Section2={{Chembox Properties | C=10|H=13|N=1|O=3 | MolarMass = | Appearance = Colorless solid | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | GHS_ref=<ref>{{cite web |title=N-Acetyldopamine |url=https://pubchem.ncbi.nlm.nih.gov/compound/100526#section=Safety-and-Hazards |website=pubchem.ncbi.nlm.nih.gov |access-date=26 February 2022 |language=en}}</ref> | GHSPictograms = {{GHS07}} | GHSSignalWord = Warning | HPhrases = {{H-phrases|315|319|335}} | PPhrases = {{P-phrases|261|264|271|280|302+352|304+340|305+351+338|312|321|332+313|337+313|362|403+233|405|501}} | MainHazards = | FlashPt = | AutoignitionPt = }} }}
'''''N''-Acetyldopamine''' is the organic compound with the formula CH<sub>3</sub>C(O)NHCH<sub>2</sub>CH<sub>2</sub>C<sub>6</sub>H<sub>3</sub>(OH)<sub>2</sub>. It is the ''N''-acetylated derivative of dopamine. This compound is a reactive intermediate in sclerotization, the process by which insect cuticles are formed by hardening molecular precursors. The catechol substituent is susceptible to redox and crosslinking.<ref>{{cite journal|doi = 10.1016/j.ibmb.2009.10.007|title = Insect cuticular sclerotization: A review|year = 2010|last1 = Andersen|first1 = Svend Olav|journal = Insect Biochemistry and Molecular Biology|volume = 40|issue = 3|pages = 166–178|pmid = 19932179}}</ref><ref>{{cite journal |doi=10.1016/S0040-4020(00)00949-2|title=Oxidative conjugation of catechols with proteins in insect skeletal systems|year=2001|last1=Kramer|first1=Karl J.|last2=Kanost|first2=Michael R.|last3=Hopkins|first3=Theodore L.|last4=Jiang|first4=Haobo|last5=Zhu|first5=Yu Cheng|last6=Xu|first6=Rongda|last7=Kerwin|first7=J.L|last8=Turecek|first8=F.|journal=Tetrahedron|volume=57|issue=2|pages=385–392}}</ref>
==References== <references />
{{DEFAULTSORT:Acetyldopamine, N-}} Category:Dopamine Category:Phenethylamine alkaloids