Monacolin J

{{Chembox | ImageFile = Monacolin J Structure.svg | ImageSize = | ImageAlt = | PIN = (4''R'',6''R'')-4-Hydroxy-6-<nowiki/>{2-[(1''S'',2''S'',6''R'',8''S'',8a''R'')-8-hydroxy-2,6-dimethyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl}oxan-2-one | OtherNames = |Section1={{Chembox Identifiers | CASNo = 79952-42-4 | CASNo_Ref = {{cascite|correct|CAS}} | ChemSpiderID = 117609 | ChEBI = 79034 | EC_number = 616-759-1 | PubChem = 9905162 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = P5IQ0SI56N | StdInChI=1S/C19H28O4/c1-11-7-13-4-3-12(2)16(19(13)17(21)8-11)6-5-15-9-14(20)10-18(22)23-15/h3-4,7,11-12,14-17,19-21H,5-6,8-10H2,1-2H3/t11-,12-,14+,15+,16-,17-,19-/m0/s1 | StdInChIKey = ZDFOBOYQVYMVCW-IRUSZSJRSA-N | SMILES = C[C@@H]1C[C@H](O)[C@@H]2[C@@H](CC[C@@H]3C[C@@H](O)CC(=O)O3)[C@@H](C)C=CC2=C1 }} |Section2={{Chembox Properties | C=19 | H=28 | O=4 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}

'''Monacolin J''' is a statin made by red yeast rice. Monacolin J is a precursor to simvastatin and has potential neuroprotective activities.<ref>{{Cite journal |last1=Campoy |first1=Sonia |last2=Sierra |first2=Saleta |last3=Suarez |first3=Beatriz |last4=Ramos |first4=Maria C. |last5=Velasco |first5=Javier |last6=Burgos |first6=Javier S. |last7=Adrio |first7=Jose L. |date=21 July 2010 |title=Semisynthesis of novel monacolin J derivatives: hypocholesterolemic and neuroprotective activities |journal=J. Antibiot. |volume=63 |issue=8 - August 2010 |pages=499–505 |doi=10.1038/ja.2010.76 |pmid=20648024 |doi-access=free}}</ref>{{Unreliable medical source|date=March 2016}}

It can be produced by total mycosynthesis.

==References== {{reflist}}

Category:Statins Category:Lactones Category:Hexahydronaphthalenes Category:Diols Category:Tetrahydropyrans {{Organic-compound-stub}}