{{Chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 444413273 | ImageFile = Mirfentanil.svg | ImageClass = skin-invert-image | ImageSize = 220px | ImageFile2 = Mifentanil 3D BS.png | ImageClass2 = bg-transparent | ImageSize2 = 220px | PIN = ''N''-[1-(2-Phenylethyl)piperidin-4-yl]-''N''-pyrazinylfuran-2-carboxamide | OtherNames = MS-32, NIH-10647 |Section1={{Chembox Identifiers | PubChem = 60698 | CASNo_Ref = {{cascite|correct|??}} | CASNo = 117523-47-4 | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 54703 | SMILES = C1CN(CCC1N(C2=NC=CN=C2)C(=O)C3=CC=CO3)CCC4=CC=CC=C4 | InChI = 1/C22H24N4O2/c27-22(20-7-4-16-28-20)26(21-17-23-11-12-24-21)19-9-14-25(15-10-19)13-8-18-5-2-1-3-6-18/h1-7,11-12,16-17,19H,8-10,13-15H2 | InChIKey = BJZZDOLVVLWFHN-UHFFFAOYAN | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C22H24N4O2/c27-22(20-7-4-16-28-20)26(21-17-23-11-12-24-21)19-9-14-25(15-10-19)13-8-18-5-2-1-3-6-18/h1-7,11-12,16-17,19H,8-10,13-15H2 | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = BJZZDOLVVLWFHN-UHFFFAOYSA-N | RTECS = | MeSHName = C069209 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = Q2U943H24P }} |Section2={{Chembox Properties | C=22 | H=24 | N=4 | O=2 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} }}
'''Mirfentanil''' is a fentanyl derivative with strong selectivity for the μ opioid receptor. At lower doses, it antagonizes the analgesic effects of alfentanil and substitutes for naloxone in morphine-treated monkeys; however, it also reverses naloxone-precipitated withdrawal in pigeons trained to discriminate morphine from naloxone.<ref name="France 1991">{{cite journal | last1 = France | first1 = CP | last2 = Winger | first2 = G | last3 = Medzihradsky | first3 = F | last4 = Seggel | first4 = MR | last5 = Rice | first5 = KC | last6 = Woods | first6 = JH | date = Aug 1991 | title = Mirfentanil: pharmacological profile of a novel fentanyl derivative with opioid and nonopioid effects | journal = Journal of Pharmacology and Experimental Therapeutics | volume = 258 | issue = 2| pages = 502–10 | doi = 10.1016/S0022-3565(25)20240-3 | pmid = 1650830 }}</ref>
At high doses, it exhibits analgesic activity which is not fully reversed by opioid antagonists, suggesting that the drug has both opioid and non-opioid mechanisms of action.<ref name="France 1991" /><ref>{{cite journal | last1 = Carr | first1 = DJ | last2 = Brockunier | first2 = LL | last3 = Scott | first3 = M | last4 = Bagley | first4 = JR | last5 = France | first5 = CP | date = Aug 1996 | title = Mirfentanil antagonizes morphine-induced suppression of splenic NK activity in mice | journal = Immunopharmacology | volume = 34 | issue = 1| pages = 9–16 | pmid = 8880221 | doi=10.1016/0162-3109(95)00051-8}}</ref>
Side effects of fentanyl analogs are similar to those of fentanyl itself, which include itching, nausea and potentially serious respiratory depression, which can be life-threatening. Fentanyl analogs have killed hundreds of people throughout Europe and the former Soviet republics since the most recent resurgence in use began in Estonia in the early 2000s, and novel derivatives continue to appear.<ref>{{cite journal | url=http://www.ijdp.org/article/S0955-3959%2815%2900097-3/abstract | title=Fentanyls: Are we missing the signs? Highly potent and on the rise in Europe. | author=Jane Mounteney | author2=Isabelle Giraudon | author3=Gleb Denissov | author4=Paul Griffiths | journal=The International Journal of Drug Policy | date=July 2015 | volume=26 | issue=7 | pages=626–631 | doi=10.1016/j.drugpo.2015.04.003 | pmid=25976511| url-access=subscription }}</ref>
== Synthesis == Mirfentanil was synthesized via acylation of the product of the reaction of 2-chloropyrazine and 1-(2-phenylethyl)-4-piperidinone oxime with 2-furoyl chloride.<ref>{{cite journal | author = Jerome R. Bagley| title = New 4-(heteroanilido)piperidines, structurally related to the pure opioidagonist fentanyl, with agonist and/or antagonist properties| journal = Journal of Medicinal Chemistry| volume = 32 | issue = 3| pages = 663–71| year = 1989| last2 = Wynn| first2 = Richard| last3 = Rudo| first3 = Frieda| last4 = Doorley| first4 = Brian| last5 = Spencer| first5 = Kenneth| last6 = Spaulding| first6 = Theodore| doi=10.1021/jm00123a028| pmid=2563773}}</ref>
==See also== * 3-Methylbutyrfentanyl * 3-Methylfentanyl * 4-Fluorofentanyl * α-Methylfentanyl * Acetylfentanyl * Butyrfentanyl * Furanylfentanyl
==References== {{Reflist|2}}
==External links== *{{Commonscatinline}}
{{Opioidergics}}
Category:Synthetic opioids Category:Piperidines Category:Aminopyrazines Category:2-Furyl compounds Category:Carboxamides Category:Mu-opioid receptor agonists