{{Chembox | ImageFile = Mexacarbate-Skeletal-2D.svg | ImageSize = | ImageAlt = | PIN = 4-(Dimethylamino)-3,5-dimethylphenyl methylcarbamate | OtherNames = Mexacarbate, Zectran; 4-Dimethylamino-3,5-xylyl methylcarbamate |Section1={{Chembox Identifiers | CASNo = 315-18-4 | CASNo_Ref = {{cascite|correct|CAS}} | ChEBI = 82092 | ChEMBL = 454804 | ChemSpiderID = 9043 | EC_number = 206-249-3 | KEGG = C18952 | PubChem = 9414 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = ZTM4IPV8G8 | UNNumber = 2757 (MEXACARBATE) | StdInChI=1S/C12H18N2O2/c1-8-6-10(16-12(15)13-3)7-9(2)11(8)14(4)5/h6-7H,1-5H3,(H,13,15) | StdInChIKey = YNEVBPNZHBAYOA-UHFFFAOYSA-N | SMILES = CC1=CC(=CC(=C1N(C)C)C)OC(=O)NC }} |Section2={{Chembox Properties | C=12 | H=18 | N=2 | O=2 | Appearance = White, crystalline solid | Density = 1.077 g/cm<sup>3</sup> | MeltingPtC = 85 | BoilingPtC = 318 | Solubility = }} |Section3={{Chembox Hazards | GHS_ref=[https://pubchem.ncbi.nlm.nih.gov/compound/9414#section=Safety-and-Hazards] | GHSPictograms = {{GHS06}}{{GHS09}} | GHSSignalWord = Danger | HPhrases = {{H-phrases|300|312|410}} | PPhrases = {{P-phrases|264|270|273|280|301+316|302+352|317|321|330|362+364|391|405|501}} | MainHazards = | FlashPtC = 146 | AutoignitionPtC = }} }}

'''Mexacarbate''' is a carbamate pesticide developed by Alexander Shulgin and marketed in 1961 by Dow Chemical Company under the trade name '''Zectran'''.<ref>{{cite book |chapter-url=https://books.google.com/books?id=ipN0t_wFCRkC&q=mexacarbate+dow+chemical&pg=PA270 |title=Aquatic Toxicology and Hazard Assessment |editor1-first=L. R. |editor1-last=Williams |page=270 |last=Sundaram |first=Kanth M. S. |chapter=Toxicity and Metabolism of Mexacarbate in Freshwater Crayfish Under Laboratory Conditions |date=August 1989 |publisher=ASTM International |isbn=080311253X |access-date=June 22, 2012}}</ref> As of 2009, Mexacarbate is considered obsolete or discontinued, according to the World Health Organization.<ref>WHO: ''Active ingredients believed to be obsolete or discontinued for use as pesticides'', in [https://www.who.int/entity/ipcs/publications/pesticides_hazard_2009.pdf ''The WHO Recommended Classification of Pesticides by Hazard and Guidelines to Classification 2009'']{{dead link|date=December 2021|bot=medic}}{{cbignore|bot=medic}} (PDF; 2,2&nbsp;MB).</ref> It is notable for being the first biodegradable pesticide.<ref>{{cite web |website=The Guardian |date= 3 June 2014|url=https://www.theguardian.com/science/2014/jun/03/alexander-shulgin |title=Obituaries / Alexander T. (Sasha) Shulgin |author=Betsy Reed}}</ref> thumb|left|Canister of mexacarbate (Zectran) thumb|Mexacarbate being sprayed by helicopter.

== References == {{reflist}}

Category:Alexander Shulgin Category:Carbamate insecticides Category:Phenol esters Category:Dimethylamino compounds

{{Ether-stub}}