{{Chembox | Name = | ImageFile = Methyllinderone.svg | ImageAlt = | ImageCaption = | IUPACName = 4,5-dimethoxy-2-[(2''E'')-1-methoxy-3-phenylprop-2-enylidene]cyclopent-4-ene-1,3-dione | SystematicName = | OtherNames = Methylliderone |Section1={{Chembox Identifiers | Abbreviations = | CASNo_Ref = {{cascite|correct|CAS}} | CASNo = 3984-73-4 | CASNo1_Ref = {{cascite|correct|CAS}} | CASNo1 = 2699712-20-2 | CASNo1_Comment = (non-specific) | ChEMBL = 44725 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = YYE85YM58K | PubChem = 10086155 | ChemSpiderID = 8261692 | ChemSpiderID_Comment = | StdInChI=1S/C17H16O5/c1-20-12(10-9-11-7-5-4-6-8-11)13-14(18)16(21-2)17(22-3)15(13)19/h4-10H,1-3H3/b10-9+ | StdInChIKey = KXRUALBXWXRUTD-MDZDMXLPSA-N | SMILES = COC1=C(C(=O)C(=C(/C=C/C2=CC=CC=C2)OC)C1=O)OC }} |Section2={{Chembox Properties | C=17 | H=16 | O=5 | MolarMass = | Appearance = | Density = | MeltingPt = | MeltingPt_notes = | BoilingPt = | BoilingPt_notes = | LogP = | VaporPressure = | HenryConstant = | AtmosphericOHRateConstant = | pKa = | pKb = | Solubility = | SolubleOther = | Solvent = }} |Section3={{Chembox Structure | CrystalStruct = | Coordination = | MolShape = }} |Section4={{Chembox Thermochemistry | DeltaHc = | DeltaHf = | Entropy = | HeatCapacity = }} |Section5={{Chembox Pharmacology | AdminRoutes = | Bioavail = | Metabolism = | HalfLife = | ProteinBound = | Excretion = | Legal_status = | Legal_US = | Legal_UK = | Legal_AU = | Legal_CA = | Pregnancy_category = | Pregnancy_AU = | Pregnancy_US = }} |Section6={{Chembox Explosive | ShockSens = | FrictionSens = | DetonationV = | REFactor = }} |Section7={{Chembox Hazards | ExternalSDS = | MainHazards = | NFPA-H = | NFPA-F = | NFPA-R = | NFPA-S = | FlashPt = | AutoignitionPt = | ExploLimits = | LD50 = | PEL = }} |Section8={{Chembox Related | OtherAnions = | OtherCations = | OtherFunction = | OtherFunction_label = | OtherCompounds = }} }}

'''Methyllinderone''' is a bio-active isolate of ''Lindera lucida''.<ref>A dihydrochalcone from Lindera lucida. Yuan-Wah Leong, Leslie J. Harrison, Graham J. Bennett, Azizol A. Kadir and Joseph D. Connolly, Phytochemistry, Volume 47, Issue 5, March 1998, Pp. 891-894, {{doi|10.1016/S0031-9422(97)00947-3}}</ref>

==References== {{reflist}}

Category:Phytochemicals Category:Methoxy compounds Category:Cyclopentenes Category:Cyclic ketones

{{organic-compound-stub}}