{{chembox | Watchedfields = | verifiedrevid = | Name = Methyl caffeate | ImageFile = Methyl caffeate.svg | ImageCaption = Chemical structure of methyl caffeate | PIN = Methyl (2''E'')-3-(3,4-dihydroxyphenyl)prop-2-enoate | OtherNames = Caffeic acid methyl ester<br>methylcaffeate<br>Methyl 3,4-dihydroxycinnamate |Section1={{Chembox Identifiers | CASNo = 3843-74-1 | CASNo_Ref = {{cascite|correct|CAS}} | ChEBI = | ChEBI_Ref = | ChEMBL = | ChEMBL_Ref = | ChemSpiderID = 600455 | SMILES = COC(=O)/C=C/C1=CC(=C(C=C1)O)O | InChI = 1/C10H10O4/c1-14-10(13)5-3-7-2-4-8(11)9(12)6-7/h2-6,11-12H,1H3/b5-3+ | InChIKey = OCNYGKNIVPVPPX-HWKANZROBE | StdInChI = 1S/C10H10O4/c1-14-10(13)5-3-7-2-4-8(11)9(12)6-7/h2-6,11-12H,1H3/b5-3+ | StdInChIKey = OCNYGKNIVPVPPX-HWKANZROSA-N | DrugBank = | DrugBank_Ref = | KEGG = | KEGG_Ref = | PubChem = 689075 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = N79173B9HF }} |Section2={{Chembox Properties | C=10 | H=10 | O=4 | Density = <!--g/cm<sup>3</sup>--> | MeltingPt = <!--&nbsp;°C--> | BoilingPt = | LambdaMax = }} |Section8={{Chembox Related | OtherCompounds = Caffeic acid, Ethyl caffeate }} }}

'''Methyl caffeate''' is an ester of caffeic acid, a naturally occurring phenolic compound. It is an α-glucosidase inhibitor.<ref>{{cite journal|title=Methyl Caffeate as an α-Glucosidase Inhibitor from Solanum torvum Fruits and the Activity of Related Compounds|journal=Bioscience, Biotechnology, and Biochemistry|volume=74|issue=4|pages=741–745|doi=10.1271/bbb.90789|pmid=20378981|year=2014|last1=Takahashi|first1=Keisuke|last2=Yoshioka|first2=Yasuyuki|last3=Kato|first3=Eisuke|last4=Katsuki|first4=Shigeki|last5=Iida|first5=Osamu|last6=Hosokawa|first6=Keizo|last7=Kawabata|first7=Jun|s2cid=23067847|doi-access=free|hdl=2115/53430|hdl-access=free}}</ref> Its physical form is a powder.

== Natural occurrences == Methyl caffeate can be found in the fruit of ''Solanum torvum''.<ref name=Gandhi>{{cite journal | doi = 10.1016/j.ejphar.2011.09.159| title = Antihyperglycemic activity and antidiabetic effect of methyl caffeate isolated from Solanum torvum Swartz. Fruit in streptozotocin induced diabetic rats| year = 2011| last1 = Gandhi| first1 = Gopalsamy Rajiv| last2 = Ignacimuthu| first2 = Savarimuthu| last3 = Paulraj| first3 = Michael Gabriel| last4 = Sasikumar| first4 = Ponnusamy| journal = European Journal of Pharmacology| volume = 670| issue = 2–3| pages = 623–631| pmid = 21963451}}</ref>

== Health effect == Methyl caffeate shows an antidiabetic effect in streptozotocin-induced diabetic rats.<ref name=Gandhi/>

== References == {{Reflist}}

{{Hydroxycinnamic acid}}

{{DEFAULTSORT:Methyl caffeate}} Category:O-methylated hydroxycinnamic acids Category:Hydroxycinnamic acid esters Category:Catechols

{{aromatic-stub}}