{{DISPLAYTITLE:''p''-Menthane}} {{confused|methane}} {{Chembox | Name = ''p''-Menthane | ImageFileL1 = Menthane, p-trans.svg | ImageSizeL1 = 42 | ImageFileR1 = Menthane, p-cis.svg | ImageSizeR1 = 42 | ImageAlt = | IUPACName = 1-isopropyl-4-methylcyclohexane | OtherNames = |Section1={{Chembox Identifiers | CASNo = 99-82-1 | CASNo_Ref = {{cascite|correct|CAS}} | UNII_Ref = {{fdacite|correct|FDA}} | UNII = CGW5GN8TXU | PubChem = 7459 | EC_number = 202-790-4 | ChemSpiderID = 7179 | InChI=1S/C10H20/c1-8(2)10-6-4-9(3)5-7-10/h8-10H,4-7H2,1-3H3 | InChIKey = CFJYNSNXFXLKNS-UHFFFAOYSA-N | SMILES = CC1CCC(CC1)C(C)C }} |Section2={{Chembox Properties | C=10|H=20 | Appearance = Colorless liquid | Density = 0.8086 g/cm<sup>3</sup> | MeltingPtC = | BoilingPtC = 168 | SolubleOther = Soluble | Solvent = organic solvents}} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}
'''''p''-Menthane''' is a hydrocarbon with the formula (CH<sub>3</sub>)<sub>2</sub>CHC<sub>6</sub>H<sub>10</sub>CH<sub>3</sub>. It is the product of the hydrogenation or hydrogenolysis of various terpenoids, including ''p''-cymene, terpinolenes, phellandrene, and limonene. It is a colorless liquid with a fragrant fennel-like odor. It occurs naturally, especially in exudates of ''Eucalyptus'' fruits. The compound is generally encountered as a mixture of the ''cis'' and ''trans'' isomers, which have very similar properties
==References== {{Reflist}}
{{DEFAULTSORT:Menthane, p-}} Category:Hydrocarbons Category:Perfume ingredients Category:Cyclohexanes Category:Isopropyl compounds