Meglumine

{{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 407762837 | ImageFile = Meglumine.svg | ImageClass = skin-invert-image | ImageFile_Ref = {{chemboximage|correct|??}} | ImageSize = 200 | ImageName = Stereo, skeletal formula of meglumine | SystematicName = (2''R'',3''R'',4''R'',5''S'')-6-(Methylamino)hexane-1,2,3,4,5-pentol | OtherNames = ''N''-Methyl-<small>D</small>-glucamine; Methylglucamine; ''N''-Methylglucamine; 1-Deoxy-1-(methylamino)-<small>D</small>-glucitol; 1-Deoxy-1-methylaminosorbitol; ''N''-Methylsorbitylamine; Meglumin  |Section1={{Chembox Identifiers | CASNo = 6284-40-8 | CASNo_Ref = {{cascite|correct|CAS}} | PubChem = 8567 | ChemSpiderID = 8249 | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | UNII = 6HG8UB2MUY | ChEBI_Ref = {{ebicite|changed|EBI}} | ChEBI = 59732 | UNII_Ref = {{fdacite|changed|FDA}} | ChEMBL = 1200570 | ChEMBL_Ref = {{ebicite|changed|EBI}} | SMILES = O[C@H]([C@@H](O)CNC)[C@H](O)[C@H](O)CO | StdInChI =1S/C7H17NO5/c1-8-2-4(10)6(12)7(13)5(11)3-9/h4-13H,2-3H2,1H3/t4-,5+,6+,7+/m0/s1 | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = MBBZMMPHUWSWHV-BDVNFPICSA-N | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} }} |Section2={{Chembox Properties | C=7 | H=17 | N=1 | O=5 | Appearance = White crystals | LogP = −2.509 | pKa = 9.52 | pKb = 0.526 }} |Section3={{Chembox Related | OtherFunction_label = | OtherFunction = | OtherCompounds = }} }}

'''Meglumine''' is a [[sugar alcohol]] derived from [[glucose]] that contains an [[amine|amino group]] modification. It is often used as an [[excipient]] in pharmaceuticals<ref>{{cite web | url = https://drugs.ncats.io/drug/6HG8UB2MUY | title = Meglumine | work = Inxight Drugs | publisher = National Center for Advancing Translational Sciences }}</ref> and in conjunction with iodinated compounds in [[contrast medium|contrast media]] such as [[diatrizoate meglumine]], [[iothalamate | iothalamate meglumine]], and [[iodipamide meglumine]].<ref>[http://www.chemicalland21.com/lifescience/phar/N-METHYL-D-GLUCAMINE.htm Meglumine], chemicalland21.com</ref>

==See also== * [[Flunixin meglumine]] * [[Meglumine antimoniate]]

==References== {{reflist}}

[[Category:Hexosamines]]