{{short description|Chemical compound}} {{drugbox | drug_name = MXiPr | image = Methoxisopropamine.svg | image_class = skin-invert-image | legal_CA = Schedule I | legal_UK = Class B | legal_DE = NpSG | C = 16 | H = 23 | N = 1 | O = 2 | IUPAC_name = 2-(isopropylamino)-2-(3-methoxyphenyl)cyclohexan-1-one | CAS_number = 2666932-55-2 | ChemSpiderID = 129433717 | PubChem = 163192824 | UNII = KHM3GXB3S9 | smiles = CC(C)NC1(CCCCC1=O)c1cccc(OC)c1 | StdInChI = 1S/C16H23NO2/c1-12(2)17-16(10-5-4-9-15(16)18)13-7-6-8-14(11-13)19-3/h6-8,11-12,17H,4-5,9-10H2,1-3H3 | StdInChIKey = FTQIVDGNGXPEKP-UHFFFAOYSA-N }}
'''MXiPr''' ('''Methoxisopropamine''', '''Isopropyloxetamine''', '''Isopropyxetamine''') is a recreational designer drug with dissociative effects. It is an arylcyclohexylamine derivative, related to drugs such as ketamine and methoxetamine. It is the N-isopropyl homologue to methoxetamine. Since it hasn't been extensively studied, the pharmacological effects are unclear, but its effects are reportedly similar to methoxetamine. It was first identified in Slovenia in December 2020,<ref>{{cite web | url = https://www.policija.si/apps/nfl_response_web/0_Analytical_Reports_final/MXiPr-ID-2197-20_report.pdf | title = Analytical Report for MXiPr | quote = (2‐(3‐methoxyphenyl)‐2‐[(propan‐2‐yl)amino]cyclohexan‐1‐one C16H23NO2) | work = National Forensic Laboratory, Police, Ministry of the Interior | publisher = Republic of Slovenia | access-date = 2021-06-09 | archive-date = 2022-01-15 | archive-url = https://web.archive.org/web/20220115185111/https://www.policija.si/apps/nfl_response_web/0_Analytical_Reports_final/MXiPr-ID-2197-20_report.pdf | url-status = bot: unknown }}</ref> and was made illegal in Hungary in April 2021.<ref>{{cite web | url = https://web.archive.org/web/20210601000000*/https://ec.europa.eu/growth/tools-databases/tris/index.cfm/en/search/?trisaction=search.detail&year=2021&num=225&dLang=EN | title = Amendment of Decree No 55/2014 of 30 December 2014 on substances or groups of compounds classified as new psychoactive substances | id = 2021/225/HU | work = Minister for Human Capacities | publisher = Government of Hungary }}</ref>
== See also == * 3-Methyl-PCP * Deoxymethoxetamine * Fluorexetamine * MDPCP * Methoxpropamine * O-PCE * Ketamine
== References == {{Reflist}}
{{Dissociatives}} {{Ionotropic glutamate receptor modulators}} {{Sigma receptor modulators}}
Category:Arylcyclohexylamines Category:Designer drugs Category:Dissociative drugs Category:3-Methoxyphenyl compounds Category:Isopropylamino compounds
{{Hallucinogen-stub}}