{{Short description|Chemical compound}} {{Drugbox | Verifiedfields = | Watchedfields = | verifiedrevid = | IUPAC_name = (2''S'')-2-<nowiki>[[</nowiki>(2''S'',4''R'')-1-[(2''R'')-2-acetamido-3-(4-hydroxyphenyl)propanoyl]-4-hydroxypyrrolidine-2-carbonyl]amino]-''N''-[(2''S'',3''R'')-1-<nowiki>[[</nowiki>(2''S'')-1-[2-<nowiki>[[</nowiki>(2''S'')-1-<nowiki>[[</nowiki>(2''S'')-1-<nowiki>[[</nowiki>(2''S'')-1-amino-3-(1''H''-indol-3-yl)-1-oxopropan-2-yl]amino]-5-[(''N''<nowiki>'</nowiki>-methylcarbamimidoyl)amino]-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamoyl]hydrazinyl]-1-oxo-3-phenylpropan-2-yl]amino]-3-hydroxy-1-oxobutan-2-yl]butanediamide<br />''or''<br />Ac-<small>D</small>-Tyr-Hyp-Asn-Thr-Phe-Unk-Leu-Arg(Me)-Trp-NH<sub>2</sub> | image = MVT-602 TAK-448.svg | image_class = skin-invert-image | width = 250px
<!--Clinical data--> | tradename = | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration = | class =
<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
<!-- Identifiers --> | CAS_number_Ref = | CAS_number = 1234319-68-6 | CAS_supplemental = | ATC_prefix = | ATC_suffix = | ATC_supplemental = | PubChem = 46700761 | IUPHAR_ligand = 10222 | DrugBank_Ref = | DrugBank = DB11975 | ChemSpiderID_Ref = | ChemSpiderID = | UNII = YO029HR229 | KEGG = | ChEBI = | ChEMBL = 3924151 | synonyms = RVT-602; TAK-448
<!--Chemical data--> | C=58 | H=80 | N=16 | O=14 | SMILES = C[C@H]([C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)NNC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(=NC)N)C(=O)N[C@@H](CC2=CNC3=CC=CC=C32)C(=O)N)NC(=O)[C@H](CC(=O)N)NC(=O)[C@@H]4C[C@H](CN4C(=O)[C@@H](CC5=CC=C(C=C5)O)NC(=O)C)O)O | StdInChI_Ref = | StdInChI = 1S/C58H80N16O14/c1-30(2)22-42(51(82)66-40(16-11-21-63-57(61)62-5)50(81)67-41(49(60)80)25-35-28-64-39-15-10-9-14-38(35)39)70-58(88)73-72-53(84)43(23-33-12-7-6-8-13-33)69-55(86)48(31(3)75)71-52(83)44(27-47(59)79)68-54(85)46-26-37(78)29-74(46)56(87)45(65-32(4)76)24-34-17-19-36(77)20-18-34/h6-10,12-15,17-20,28,30-31,37,40-46,48,64,75,77-78H,11,16,21-27,29H2,1-5H3,(H2,59,79)(H2,60,80)(H,65,76)(H,66,82)(H,67,81)(H,68,85)(H,69,86)(H,71,83)(H,72,84)(H3,61,62,63)(H2,70,73,88)/t31-,37-,40+,41+,42+,43+,44+,45-,46+,48+/m1/s1 | StdInChIKey_Ref = | StdInChIKey = MWXWMWSUUYXMRA-GRKBUMBKSA-N }}
'''MVT-602''' (other developmental code names '''RVT-602''', '''TAK-448''') is a kisspeptin receptor agonist which is under development for the treatment of female infertility and hypogonadism.<ref name="AdisInsight">{{cite web | title = MVT 602 | url = https://adisinsight.springer.com/drugs/800029425 | work = Adis Insight | publisher = Springer Nature Switzerland AG }}</ref><ref name="pmid33196464">{{cite journal | vauthors = Abbara A, Eng PC, Phylactou M, Clarke SA, Richardson R, Sykes CM, Phumsatitpong C, Mills E, Modi M, Izzi-Engbeaya C, Papadopoulou D, Purugganan K, Jayasena CN, Webber L, Salim R, Owen B, Bech P, Comninos AN, McArdle CA, Voliotis M, Tsaneva-Atanasova K, Moenter S, Hanyaloglu A, Dhillo WS | display-authors = 6 | title = Kisspeptin receptor agonist has therapeutic potential for female reproductive disorders | journal = The Journal of Clinical Investigation | volume = 130 | issue = 12 | pages = 6739–6753 | date = December 2020 | pmid = 33196464 | pmc = 7685751 | doi = 10.1172/JCI139681 }}</ref> It has been found to increase luteinizing hormone levels in premenopausal women.<ref name="pmid33196464" /> As of March 2021, MVT-602 is in phase 2 clinical trials for the treatment of female infertility and hypogonadism.<ref name="AdisInsight" /> It was also under development for the treatment of prostate cancer, but development for this indication was discontinued.<ref name="AdisInsight" />
== References == {{Reflist}}
== External links == * [https://adisinsight.springer.com/drugs/800029425 MVT-602 - AdisInsight]
Category:Experimental drugs Category:Peptide therapeutics {{Genito-urinary-drug-stub}}