{{cs1 config|name-list-style=vanc|display-authors=6}} {{Drugbox | IUPAC_name = 1-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]pyrrolidine-2,5-dione | image = MM-77_structure.png | image_class = skin-invert-image | width = 250px
<!--Clinical data--> | tradename = | routes_of_administration = | class = Serotonin 5-HT<sub>1A</sub> receptor antagonist
<!--Identifiers--> | CAS_number = 159187-70-9 | ATC_prefix = None | PubChem = 3994476 | IUPHAR_ligand = | ChEMBL_Ref = | ChEMBL = | ChemSpiderID =
<!--Chemical data--> | C = 19 | H = 27 | N = 3 | O = 3 | SMILES = COC1=CC=CC=C1N2CCN(CC2)CCCCN3C(=O)CCC3=O | StdInChI = 1S/C19H27N3O3/c1-25-17-7-3-2-6-16(17)21-14-12-20(13-15-21)10-4-5-11-22-18(23)8-9-19(22)24/h2-3,6-7H,4-5,8-15H2,1H3 | StdInChIKey = MQHOGPLXAXSQAJ-UHFFFAOYSA-N }}
'''MM-77''' is a piperazine derivative which is a serotonergic drug, acting as a potent and selective 5-HT<sub>1A</sub> receptor antagonist. It is used for research into the 5-HT<sub>1A</sub> receptor and has anxiolytic effects in animal models.<ref>{{cite journal | vauthors = Griebel G, Rodgers RJ, Perrault G, Sanger DJ | title = Behavioural profiles in the mouse defence test battery suggest anxiolytic potential of 5-HT(1A) receptor antagonists | journal = Psychopharmacology | volume = 144 | issue = 2 | pages = 121–130 | date = May 1999 | pmid = 10394992 | doi = 10.1007/s002130050984 }}</ref><ref>{{cite journal | vauthors = Griebel G, Rodgers RJ, Perrault G, Sanger DJ | title = The effects of compounds varying in selectivity as 5-HT(1A) receptor antagonists in three rat models of anxiety | journal = Neuropharmacology | volume = 39 | issue = 10 | pages = 1848–1857 | date = July 2000 | pmid = 10884565 | doi = 10.1016/s0028-3908(00)00074-5 }}</ref><ref>{{cite journal | vauthors = Wesołowska A, Paluchowska M, Chojnacka-Wójcik E | title = Involvement of presynaptic 5-HT(1A) and benzodiazepine receptors in the anticonflict activity of 5-HT(1A) receptor antagonists | journal = European Journal of Pharmacology | volume = 471 | issue = 1 | pages = 27–34 | date = June 2003 | pmid = 12809949 | doi = 10.1016/s0014-2999(03)01814-4 }}</ref><ref>{{cite journal | vauthors = Bojarski AJ, Duszyńska B, Kołaczkowski M, Kowalski P, Kowalska T | title = The impact of spacer structure on 5-HT7 and 5-HT1A receptor affinity in the group of long-chain arylpiperazine ligands | journal = Bioorganic & Medicinal Chemistry Letters | volume = 14 | issue = 23 | pages = 5863–5866 | date = December 2004 | pmid = 15501057 | doi = 10.1016/j.bmcl.2004.09.029 }}</ref><ref>{{cite journal | vauthors = Alfredo BA, Ofir P | date = January 2005 | title = Effect of the postsynaptic 5-HT1A receptor antagonist MM-77 on stressed mice treated with 5-HT1A receptor agents | journal = European Journal of Pharmacology | volume = 508 | issue = 1–3 | pages = 155–158 | doi = 10.1016/j.ejphar.2004.12.013 | pmid = 15680266 }}</ref><ref>{{cite journal | vauthors = Briones-Aranda A, Castillo-Salazar M, Picazo O | title = Adrenalectomy modifies the hippocampal 5-HT(1A) receptors and the anxiolytic-like effect of 8-OH-DPAT in rats | journal = Pharmacology, Biochemistry, and Behavior | volume = 92 | issue = 1 | pages = 182–189 | date = March 2009 | pmid = 19095004 | doi = 10.1016/j.pbb.2008.11.008 }}</ref>
== See also == * 2-Methoxyphenylpiperazine * SL88.0338 * WAY-100635
== References == {{Reflist}}
{{Serotonergics}} {{Piperazines}}
Category:5-HT1A antagonists Category:Piperazines
{{nervous-system-drug-stub}}