MK6892

{{cs1 config|name-list-style=vanc|display-authors=6}} {{Infobox drug | IUPAC_name = <nowiki>2-[[3-[3-(5-hydroxypyridin-2-yl)-1,2,4-oxadiazol-5-yl]-2,2-dimethylpropanoyl]amino]cyclohexene-1-carboxylic acid</nowiki> | image = MK6892_structure.png | image_class = skin-invert-image | width =

| tradename = | routes_of_administration =

| C=19 | H=22 | N=4 | O=5 | smiles = CC(C)(CC1=NC(=NO1)C2=NC=C(C=C2)O)C(=O)NC3=C(CCCC3)C(=O)O | StdInChI = 1S/C19H22N4O5/c1-19(2,18(27)21-13-6-4-3-5-12(13)17(25)26)9-15-22-16(23-28-15)14-8-7-11(24)10-20-14/h7-8,10,24H,3-6,9H2,1-2H3,(H,21,27)(H,25,26) | StdInChIKey = CJHXBFSJXDUJHP-UHFFFAOYSA-N }}

'''MK6892''' is an experimental drug which acts as a potent and selective agonist for the Hydroxycarboxylic acid receptor 2 (GPR109A). It has been investigated for lowering blood lipid levels and potential applications in the treatment of colon cancer.<ref>{{cite journal | vauthors = Shen HC, Ding FX, Raghavan S, Deng Q, Luell S, Forrest MJ, Carballo-Jane E, Wilsie LC, Krsmanovic ML, Taggart AK, Wu KK, Wu TJ, Cheng K, Ren N, Cai TQ, Chen Q, Wang J, Wolff MS, Tong X, Holt TG, Waters MG, Hammond ML, Tata JR, Colletti SL | title = Discovery of a biaryl cyclohexene carboxylic acid (MK-6892): a potent and selective high affinity niacin receptor full agonist with reduced flushing profiles in animals as a preclinical candidate | journal = Journal of Medicinal Chemistry | volume = 53 | issue = 6 | pages = 2666–2670 | date = March 2010 | pmid = 20184326 | doi = 10.1021/jm100022r }}</ref><ref>{{cite journal | vauthors = Yang Y, Kang HJ, Gao R, Wang J, Han GW, DiBerto JF, Wu L, Tong J, Qu L, Wu Y, Pileski R, Li X, Zhang XC, Zhao S, Kenakin T, Wang Q, Stevens RC, Peng W, Roth BL, Rao Z, Liu ZJ | title = Structural insights into the human niacin receptor HCA2-G<sub>i</sub> signalling complex | journal = Nature Communications | volume = 14 | issue = 1 | article-number = 1692 | date = March 2023 | pmid = 36973264 | pmc = 10043007 | doi = 10.1038/s41467-023-37177-6 | bibcode = 2023NatCo..14.1692Y }}</ref><ref>{{cite journal | vauthors = Li N, Niu L, Liu Y, Wang Y, Su X, Xu C, Sun Z, Guo H, Gong J, Shen S | title = Taking SCFAs produced by Lactobacillus reuteri orally reshapes gut microbiota and elicits antitumor responses | journal = Journal of Nanobiotechnology | volume = 22 | issue = 1 | article-number = 241 | date = May 2024 | pmid = 38735933 | pmc = 11089779 | doi = 10.1186/s12951-024-02506-4 | doi-access = free }}</ref><ref>{{cite journal | vauthors = Wang J, Qian Y, Han Z, Wang Y, Liu Y, Li J, Duanmu Q, Ye S, Qiao A, Wu S | title = Insights into the Activation Mechanism of HCA1, HCA2, and HCA3 | journal = Journal of Medicinal Chemistry | volume = 68 | issue = 4 | pages = 4527–4539 | date = February 2025 | pmid = 39936872 | pmc = 11873900 | doi = 10.1021/acs.jmedchem.4c02567 }}</ref>

== References == {{Reflist}}

Category:Experimental drugs Category:Cyclohexenes Category:Carboxylic acids Category:Carboxamides Category:Disubstituted pyridines Category:Hydroxyarenes Category:Oxadiazoles