{{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 433898320 | Name = {{sm|d}}-Xylonic acid |ImageFile=xylonic acid.png |ImageSize= |IUPACName=(2''R'',3''S'',4''R'')-2,3,4,5-tetrahydroxypentanoic acid |OtherNames= {{ubl|{{sm|d}}-Xylonic acid|{{sm|d}}-''xylo''-Pentonic acid}} |Section1={{Chembox Identifiers | CASNo=17828-56-7 | CASNo_Ref = {{cascite|correct|CAS}} | UNII_Ref = {{fdacite|correct|FDA}}

| UNII = OCI0V55QO1 | CASNo_Comment = ({{sm|d}}/{{sm|l}}) | CASNo2_Ref = {{cascite|changed|??}} | CASNo2 = 526-91-0 | CASNo2_Comment = ({{sm|d}}) | CASNo3_Ref = {{cascite|changed|??}} | CASNo3 = 4172-44-5 | CASNo3_Comment = ({{sm|l}}>) | ChEBI = 48093 | ChEBI_Comment = ({{sm|d}}) | ChEBI2 = 48092 | ChEBI2_Comment = ({{sm|l}}) | PubChem=6602431 | SMILES=C([C@H]([C@@H]([C@H](C(=O)O)O)O)O)O | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 5034782 | InChI = 1/C5H10O6/c6-1-2(7)3(8)4(9)5(10)11/h2-4,6-9H,1H2,(H,10,11)/t2-,3+,4-/m1/s1 | InChIKey = QXKAIJAYHKCRRA-FLRLBIABBX | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C5H10O6/c6-1-2(7)3(8)4(9)5(10)11/h2-4,6-9H,1H2,(H,10,11)/t2-,3+,4-/m1/s1 | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = QXKAIJAYHKCRRA-FLRLBIABSA-N }} |Section2={{Chembox Properties | Formula={{chem|C|5|H|10|O|6}} | MolarMass=166.13 g/mol | Appearance= white solid | Density= | MeltingPtC= 120-122 | BoilingPt= | Solubility= }} |Section3={{Chembox Hazards | MainHazards= | FlashPt= | AutoignitionPt= }} }}

'''Xylonic acid''' is the organic compound with the formula {{chem2|HOCH2CH(OH)CH(OH)CH(OH)CO2H}}. It is an oxidized derivative of xylose. Xylonic acid is a colorless, water-soluble solid. Several isomers are known, all being classified as sugar acids, several of which can be obtained by oxidation of the corresponding pentoses. The C-2 epimer of xylonic acid is known as lyxonic acid.

Like other sugar acids, xylonic acid readily converts to a lactone (RN 15384-37-9) by dehydration. Lyxonic acid behaves similarly.

Genetically engineered ''Pseudomonas fragi'' converts D-xylose to D-xylonic acid. Decarboxylation of the xylonic acid by a strain of ''Escherichia coli'' give 1,2,4-butanetriol, which is of commercial interest.<ref>{{cite journal |doi=10.1021/ja036391|pmid=14570452 |date=2003 |last1=Niu |first1=W. |last2=Molefe |first2=M. N. |last3=Frost |first3=J. W. |title=Microbial synthesis of the energetic material precursor 1,2,4-butanetriol |journal=Journal of the American Chemical Society |volume=125 |issue=43 |pages=12998–12999 }}</ref><ref>{{cite journal |doi=10.1186/s13068-020-01744-6|doi-access=free |title=Engineering Microbial Pathways for Production of Bio-based Chemicals from Lignocellulosic Sugars: Current Status and Perspectives |date=2020 |last1=Francois |first1=Jean Marie |last2=Alkim |first2=Ceren |last3=Morin |first3=Nicolas |journal=Biotechnology for Biofuels |volume=13 |page=118 |pmid=32670405 |pmc=7341569 }}</ref>

==References== <references/>

Category:Sugar acids Category:Monosaccharides

{{Carbohydrate-stub}}