Lotiglipron

{{Short description|Chemical compound}} {{infobox drug | drug_name = Lotiglipron | image = Lotiglipron.svg | image_class = skin-invert-image | width = 280 | legal_UK = | legal_US = | legal_DE = | C = 31 | H = 31 | Cl = 1 | N = 4 | O = 5 | IUPAC_name = <nowiki>2-{[4-[(2S)-2-(5-chloropyridin-2-yl)-2-methyl-1,3-benzodioxol-4-yl]piperidin-1-yl]methyl}-3-{[(2S)-oxetan-2-yl]methyl}benzimidazole-5-carboxylic acid</nowiki> | CAS_number = 2401892-75-7 | ChemSpiderID = 129109088 | PubChem = 146609022 | UNII = YI10W1K93A | ChEMBL = 5314631 | smiles = C[C@]1(c2ccc(Cl)cn2)Oc2cccc(C3CCN(Cc4nc5ccc(C(=O)O)cc5n4C[C@@H]4CCO4)CC3)c2O1 | StdInChI = 1S/C31H31ClN4O5/c1-31(27-8-6-21(32)16-33-27)40-26-4-2-3-23(29(26)41-31)19-9-12-35(13-10-19)18-28-34-24-7-5-20(30(37)38)15-25(24)36(28)17-22-11-14-39-22/h2-8,15-16,19,22H,9-14,17-18H2,1H3,(H,37,38)/t22-,31-/m0/s1 | StdInChIKey = SVPYZAJTWFQTSM-UGDMGKLASA-N }}

'''Lotiglipron''' is a non-peptide GLP-1 receptor agonist which was under development by Pfizer as a weight loss drug.<ref>{{cite patent | url = https://patents.google.com/patent/US10676465B2 | inventor = Aspnes GE, et al. | assign1 = Pfizer Inc | gdate = 9 June 2020 | title = GLP-1 receptor agonists and uses thereof | country = US | number = 10676465 }}</ref> However, it was withdrawn from development in June 2023, after early stage clinical trials showed elevated liver enzymes which could indicate potential for liver toxicity.<ref>{{cite magazine | url = https://time.com/6290227/pfizer-shares-drop-after-lotiglipron-pause/ | vauthors = Griffin M | title = Pfizer Shares Drop After It Halts Development of Obesity Drug Due to Safety Concerns. | magazine = Time | date = 26 June 2023 }}</ref>

==See also== * Danuglipron * Orforglipron

== References == {{reflist}}

Category:Experimental drugs Category:GLP-1 receptor agonists Category:Chloropyridines Category:Piperidines Category:Benzimidazoles Category:Benzodioxoles Category:Oxetanes Category:Carboxylic acids Category:Disubstituted pyridines