{{Chembox | ImageFile = Lophenol.svg | ImageSize = | ImageAlt = | IUPACName =(3S,4S,5S,9R,10S,13R,14R,17R)-4,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol | PIN = | OtherNames = |Section1={{Chembox Identifiers | CASNo = 481-25-4 | CASNo_Ref = {{Cascite|correct|CAS}} | PubChem = 160482 | ChemSpiderID = 141024 | UNII = X4BL075LYS | ChEBI = 18378 | KEGG = C08825 | 3DMet = | SMILES = C[C@@H]1[C@H](CC[C@]2([C@H]1CC=C3[C@@H]2CC[C@]4([C@H]3CC[C@@H]4[C@H](C)CCCC(C)C)C)C)O | InChI = 1S/C28H48O/c1-18(2)8-7-9-19(3)22-12-13-24-21-10-11-23-20(4)26(29)15-17-28(23,6)25(21)14-16-27(22,24)5/h10,18-20,22-26,29H,7-9,11-17H2,1-6H3/t19-,20+,22-,23+,24+,25+,26+,27-,28+/m1/s1 | InChIKey = LMYZQUNLYGJIHI-SPONXPENSA-N }} |Section2={{Chembox Properties | C=28 | H=48 | O=1 | Appearance = | Density = | MeltingPtC = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }} '''Lophenol''', or '''4α-methyllathosterol''', also called '''4-Methylcholest-7-en-3-ol''', is a Metabolic intermediate of plant sterol biosynthesis.<ref>{{cite journal |last1=Ullah |first1=H |last2=Khan |first2=A |last3=Rehman |first3=NU |last4=Halim |first4=SA |last5=Khan |first5=H |last6=Khan |first6=I |last7=Csuk |first7=R |last8=Al-Rawahi |first8=A |last9=Al-Hatmi |first9=S |last10=Al-Harrasi |first10=A |title=Lophenol and lathosterol from resin of Commiphora kua possess hepatoprotective effects in vivo. |journal=Journal of Ethnopharmacology |date=24 April 2020 |volume=252 |article-number=112558 |doi=10.1016/j.jep.2020.112558 |pmid=31926985|s2cid=210166705 }}</ref> ==See also== * 24-Methylenelophenol * Lathosterol
==References== {{reflist}} Category:Sterols
{{steroid-stub}}