{{Short description|Chemical compound}} {{cs1 config|name-list-style=vanc}} {{Infobox drug | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 443997056 | IUPAC_name = (3R)-3-methyl-4-morpholin-4-yl-2,2-diphenyl-1-pyrrolidin-1-yl-butan-1-one | image = Levomoramide.svg | image_class = skin-invert-image <!--Clinical data--> | tradename = | pregnancy_category = | legal_AU = S8 | legal_BR = A1 | legal_BR_comment = <ref>{{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-04-04}}</ref> | legal_CA = Schedule I | legal_US = Schedule I | legal_UN = N I | legal_DE = Anlage II | routes_of_administration = <!--Pharmacokinetic data--> | bioavailability = | metabolism = | excretion = <!--Identifiers--> | ATC_prefix = none | ATC_suffix = | PubChem = 10453145 | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 7M86YFN15D | CAS_number_Ref = {{cascite|changed|??}} | CAS_number = 5666-11-5 | KEGG_Ref = {{keggcite|correct|kegg}} | KEGG = D12695 | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 8628561 | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C25H32N2O2/c1-21(20-26-16-18-29-19-17-26)25(22-10-4-2-5-11-22,23-12-6-3-7-13-23)24(28)27-14-8-9-15-27/h2-7,10-13,21H,8-9,14-20H2,1H3/t21-/m0/s1 | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = INUNXTSAACVKJS-NRFANRHFSA-N <!--Chemical data--> | C=25 | H=32 | N=2 | O=2 | smiles = C[C@@H](CN1CCOCC1)C(c1ccccc1)(c1ccccc1)C(=O)N1CCCC1 }}
'''Levomoramide''' is the inactive isomer of the opioid analgesic dextromoramide, invented by the chemist Paul Janssen in 1956. Unlike dextromoramide, which is a potent analgesic with high abuse potential, levomoramide is virtually without activity.<ref>{{cite journal | vauthors = Janssen PA, Janseen JC | title = A new series of potent analgesics. | journal = Journal of the American Chemical Society | date = August 1956 | volume = 78 | issue = 15 | pages = 3862 | doi = 10.1021/ja01596a087 | bibcode = 1956JAChS..78.3862J }}</ref><ref>{{cite journal | vauthors = Janssen PA, Jageneau AH | title = A new series of potent analgesics. | journal = Journal of Pharmacy and Pharmacology | date = September 1957 | volume = 9 | issue = 1 | pages = 381–400 | doi = 10.1111/j.2042-7158.1957.tb12290.x | s2cid = 58956931 }}</ref>
"Resolution reveals that the analgetic activity in this case resides almost entirely in the (+) isomer."<ref>{{cite book | first = Daniel | last = Lednicer | title = Central Analgetics | date = 1982 | page = 194 | publisher = Wiley | isbn = 0-471-08314-3 }}</ref>
"In the α-CH<sub>3</sub> series, one of the optical isomers of each enantiomorphic pair is about twice as active as the racemic mixture; the other isomer is devoid of significant analgesic activity."<ref>{{cite book | vauthors = Janssen PA | title = Synthetic Analgesics Part 1: Diphenylpropylamines | publisher = Pergamon Press | date = 1960 | page = 143 }}</ref>
However, despite being inactive, levomoramide is scheduled by UN Single Convention on Narcotic Drugs.
==References== {{Reflist|2}}
Category:Synthetic opioids Category:4-Morpholinyl compounds Category:1-Pyrrolidinyl compounds Category:Carboxamides
{{Ether-stub}}