{{Chembox <!-- Images --> | ImageFile = Koningic acid.svg | ImageClass = skin-invert-image | ImageSize = 200px | ImageAlt = <!-- Names --> | PIN = (2′''S'',5a''S'',6''R'',9a''S'')-1-Oxo-6-(propan-2-yl)-1,5a,6,7,8,9a-hexahydro-3''H''-spiro[<nowiki/>[2]benzoxepine-9,2′-oxirane]-4-carboxylic acid | OtherNames = (+)-Heptelidic acid <!-- Sections --> | Section1 = {{Chembox Identifiers | CASNo_Ref = {{cascite|correct|CAS}} | CASNo = 57710-57-3 | ChEBI = 214314 | ChEMBL = 3585922 | ChemSpiderID = 9121060 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 6H8EDV2NKQ | PubChem = 10945834 | StdInChI=1S/C15H20O5/c1-8(2)10-3-4-15(7-20-15)12-11(10)5-9(13(16)17)6-19-14(12)18/h5,8,10-12H,3-4,6-7H2,1-2H3,(H,16,17)/t10-,11-,12-,15-/m1/s1 | StdInChIKey = JESMSCGUTIEROV-RTWAVKEYSA-N | SMILES = CC(C)[C@H]1CC[C@@]2(CO2)[C@@H]3[C@@H]1C=C(COC3=O)C(=O)O | QID = Q48791494 }} | Section2 = {{Chembox Properties | C=15|H=20|O=5 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} | Section3 = {{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }} '''Koningic acid''' ('''KA''', also known as '''heptelidic acid''') is a potent, selective, irreversible GAPDH inhibitor.<ref>{{cite web|url=https://www.abcam.com/en-us/products/biochemicals/heptelidic-acid-koningic-acid-gapdh-inhibitor-ab144269|title=Heptelidic acid (Koningic acid) - Abcam|website=www.abcam.com}}</ref><ref>{{cite journal | doi = 10.7164/antibiotics.38.920 | pmid = 4030504 | title = Specific inhibition of glyceraldehyde-3-phosphate dehydrogenase by koningic acid (Heptelidic acid) | journal = The Journal of Antibiotics | volume = 38 | issue = 7 | pages = 920–5 | year = 1985 | last1 = Endo | first1 = Akira | last2 = Hasum | first2 = Kenji | last3 = Hasumi | first3 = Kenji | last4 = Sakai | first4 = Kaoru | last5 = Kanbe | first5 = Tomomi | doi-access = free }}</ref> It is also a DNA polymerase inhibitor. The koningic acid molecule, produced by fungi that consume sweet potatoes, has been shown to curb the excessive glucose consumption in tumors exhibiting the Warburg effect and leaving healthy cells alone.<ref>{{cite web|url=https://medicalxpress.com/news/2017-09-natural-molecule-cancer-cells-energy.html|title=Natural molecule appears to shut off cancer cells' energy source|publisher=}}</ref>
==References== {{Reflist}}
Category:Carboxylic acids Category:Sesquiterpene lactones Category:Epoxides Category:Benzoxepines Category:Lactones Category:Isopropyl compounds Category:Spiro compounds
{{Ether-stub}}