{{Short description|Experimental drug}} {{Infobox drug | drug_name = | image = Itruvone.svg | image_class = skin-invert-image | width = 225px | caption =
<!-- Clinical data --> | pronounce = | tradename = | Drugs.com = | MedlinePlus = | licence_CA = | licence_EU = | DailyMedID = | licence_US = | pregnancy_AU = | pregnancy_category = | dependency_liability = | addiction_liability = | routes_of_administration = Intranasal (spray) | class = Vomeropherine | ATC_prefix = | ATC_suffix =
<!-- Legal status --> | legal_status =
<!-- Pharmacokinetic data --> | bioavailability = | protein_bound = | metabolism = | metabolites = | onset = | elimination_half-life = | duration_of_action = | excretion =
<!-- Identifiers --> | CAS_number = 21321-89-1 | CAS_supplemental = | PubChem = 15633961 | IUPHAR_ligand = | DrugBank = | ChemSpiderID = 18829396 | UNII = 72HML2UK6J | KEGG = D12542 | ChEBI = | ChEMBL = | NIAID_ChemDB = | PDB_ligand = | synonyms = PH10; PH10A; PH10 NS; Pregn-4-en-20-yn-3-one
<!-- Chemical data --> | IUPAC_name = (8S,9S,10R,13S,14S,17R)-17-ethynyl-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one | C=21 | H=28 | O=1 | SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2C#C)CCC4=CC(=O)CC[C@]34C | StdInChI = 1S/C21H28O/c1-4-14-6-8-18-17-7-5-15-13-16(22)9-11-21(15,3)19(17)10-12-20(14,18)2/h1,13-14,17-19H,5-12H2,2-3H3/t14-,17-,18-,19-,20+,21-/m0/s1 | StdInChIKey = CHOUAXDNNAVGHR-NWSAAYAGSA-N }}
'''Itruvone''' ({{Abbrlink|INN|International Nonproprietary Name}}; developmental code name '''PH10'''), also known as '''pregn-4-en-20-yn-3-one''', is a vomeropherine which is under development by VistaGen Therapeutics as a nasal spray for the treatment of major depressive disorder.<ref name="AdisInsight">{{cite web | url = http://adisinsight.springer.com/drugs/800043336 | title = PH-10 Nasal Spray | work = AdisInsight | publisher = Springer Nature Switzerland AG }}</ref><ref name="pmid33092667">{{cite journal | vauthors = Monti L, Liebowitz MR | title = Neural circuits of anxiolytic and antidepressant pherine molecules | journal = CNS Spectr | volume = 27 | issue = 1 | pages = 66–72 | date = February 2022 | pmid = 33092667 | doi = 10.1017/S109285292000190X | s2cid = 225053518 | url = | doi-access = free }}</ref><ref>{{cite web|url=https://www.vistagen.com/news-media/press-releases/detail/100/vistagen-therapeutics-acquires-worldwide-rights-to-develop|title=VistaGen Therapeutics Acquires Worldwide Rights to Develop and Commercialize PH10, a First-in-Class Intranasally Administered Neuroactive Steroid with Rapid-onset Antidepressant Effects for Major Depressive Disorder Demonstrated in Phase 2a Study :: VistaGen Therapeutics, Inc. (VTGN)|website=VistaGen Therapeutics, Inc.|language=en|access-date=2019-12-19|archive-date=2019-12-19|archive-url=https://web.archive.org/web/20191219175855/https://www.vistagen.com/news-media/press-releases/detail/100/vistagen-therapeutics-acquires-worldwide-rights-to-develop|url-status=dead}}</ref><ref>{{cite web |date=October 29, 2018|title=Health Care Digest: A small biotech goes head first, Gilead's lower tax rate and more|url=https://www.bizjournals.com/sanfrancisco/news/2018/10/29/depression-ketamine-vistagen-vtgn-gilead-taxes.html|archive-url=|archive-date=|access-date=20 July 2020|website=www.bizjournals.com|publisher=San Francisco Business Times}}</ref><ref name="Liebowitz2013">{{cite conference| vauthors = Liebowitz MR, Nicolini H, Monti L, Hanover R |title=PH 10 may be a new rapidly acting intranasally administered antidepressant|date=2013|volume=American Society of Clinical Psychopharmacology (ASCP) Annual Meeting, Miami, FL}}</ref><ref name="Jancin2013">{{cite web | title = Novel intranasal antidepressant shows results after 1 week | last = Jancin | first = Bruce | name-list-style = vanc | year = 2013 | publisher = Clinical Psychiatry News | accessdate = 13 January 2016 | url = http://www.clinicalpsychiatrynews.com/specialty-focus/depression/single-article-page/novel-intranasal-antidepressant-shows-results-after-1-week/f88c1d176634f223babe0169c6f4af2f.html}}</ref>
==See also== * List of neurosteroids § Pheromones and pherines * List of investigational antidepressants * Fasedienol (PH94B; Aloradine) * Refisolone (PH80, Salubrin)
==References== {{Reflist}}
{{Pheromones and pherines}}
Category:Ethynyl compounds Category:Experimental antidepressants Category:Ketones Category:Pregnanes
{{Nervous-system-drug-stub}}