{{Chembox | ImageFile =Involutin.svg | ImageSize = 200px | Name=Involutin | PIN=(4''S'',5''R'')-5-(3,4-Dihydroxyphenyl)-3,4-dihydroxy-2-(4-hydroxyphenyl)cyclopent-2-en-1-one | OtherNames= |Section1={{Chembox Identifiers | ChemSpiderID = 68023767 | CASNo= 13677-78-6 | CASNo_Ref = {{Cascite|changed|??}} | PubChem=71435043 | SMILES =O[C@H]1[C@H](C(=O)C(=C1O)C1=CC=C(O)C=C1)C1=CC=C(O)C(O)=C1 | StdInChI=1S/C17H14O6/c18-10-4-1-8(2-5-10)13-15(21)14(17(23)16(13)22)9-3-6-11(19)12(20)7-9/h1-7,13,16,18-20,22-23H | StdInChIKey = JDHDWVVITVZZFY-UHFFFAOYSA-N }} |Section2={{Chembox Properties | C=17 | H=14 | O=6 | Appearance= | Density= | MeltingPt= | BoilingPt= | Solubility= }} |Section3={{Chembox Hazards | MainHazards= | FlashPt= | AutoignitionPt = }} }}
'''Involutin''' is an organic compound that can be found in mushrooms belonging to the genus ''Paxillus.'' It is part of a class of compounds known as diarylcyclopentenones. It is derived from atromentin which was shown from 3′,3″,5′,5″-''d4''-atromentin (deuterated atromentin) feeding studies and observing the deuterated incorporation into two atromentin derivatives (i.e., an increase in monoisotopic mass by 4 mass units), gyrocyanin and its oxidation product gyroporin.<ref>{{cite journal | pmid = 26496685| year = 2015| last1 = Braesel| first1 = J| title = Three Redundant Synthetases Secure Redox-Active Pigment Production in the Basidiomycete Paxillus involutus| journal = Chemistry & Biology| volume = 22| issue = 10| pages = 1325–34| last2 = Götze| first2 = S| last3 = Shah| first3 = F| last4 = Heine| first4 = D| last5 = Tauber| first5 = J| last6 = Hertweck| first6 = C| last7 = Tunlid| first7 = A| last8 = Stallforth| first8 = P| last9 = Hoffmeister| first9 = D| doi = 10.1016/j.chembiol.2015.08.016| doi-access = free}}</ref> It has been shown to be a Fe<sup>3+</sup>-reductant and presumed to be involved in Fenton chemistry for the initial attack of dead plant matter.<ref>{{cite journal | pmc = 4644656| year = 2015| last1 = Shah| first1 = F| title = Involutin is an Fe3+ Reductant Secreted by the Ectomycorrhizal Fungus Paxillus involutus during Fenton-Based Decomposition of Organic Matter| journal = Applied and Environmental Microbiology| volume = 81| issue = 24| pages = 8427–8433| last2 = Schwenk| first2 = D| last3 = Nicolás| first3 = C| last4 = Persson| first4 = P| last5 = Hoffmeister| first5 = D| last6 = Tunlid| first6 = A| doi = 10.1128/AEM.02312-15| pmid=26431968}}</ref>
==References== <references />
Category:Polyphenols Category:Cyclopentenes
{{phenol-stub}}