{{Chembox | ImageFile = Indolium.png | PIN = 1''H''-Indol-1-ium |Section1={{Chembox Identifiers | CASNo = 783272-65-1 | PubChem = 4528438 | ChemSpiderID = 3723290 | ChEBI = 52840 | StdInChI=1S/C8H7N/c1-2-4-8-7(3-1)5-6-9-8/h1-6,9H/p+1 | StdInChIKey = SIKJAQJRHWYJAI-UHFFFAOYSA-O | SMILES = C1=CC=C2C(=C1)C=C[NH2+]2 }} |Section2={{Chembox Properties | C=8|H=8|N=1|Formula_Charge=+1 }} }} '''Indolium''' is a cation with molecular formula C<sub>8</sub>H<sub>8</sub>N<sup>+</sup>, and forms chemical compounds in combination with anions. It is an onium ion derived from its parent compound, indole, by the addition of a proton.<ref>{{Cite web |title=Indolium |url=https://pubchem.ncbi.nlm.nih.gov/compound/4528438 |access-date=2020-09-08 |website=National Center for Biotechnology Information}}</ref>
==References== {{Reflist}}
Category:Indoles
{{heterocyclic-stub}}