{{Chembox | ImageFile = Imidocarb.svg | ImageClass = skin-invert-image | PIN = ''N'',''N''′-Bis[3-(4,5-dihydro-1''H''-imidazol-2-yl)phenyl]urea | OtherNames = Imizocarb; Imizol; Diamidine |Section1={{Chembox Identifiers | CASNo = 27885-92-3 | CASNo_Ref = {{cascite|correct|CAS}} | PubChem = 21389 | ChemSpiderID = 20102 | UNII = 8USS3K0VDH | SMILES = O=C(Nc2cc(C/1=N/CCN\1)ccc2)Nc3cccc(c3)/C4=N/CCN4 | InChI = 1/C19H20N6O/c26-19(24-15-5-1-3-13(11-15)17-20-7-8-21-17)25-16-6-2-4-14(12-16)18-22-9-10-23-18/h1-6,11-12H,7-10H2,(H,20,21)(H,22,23)(H2,24,25,26) | InChIKey = SCEVFJUWLLRELN-UHFFFAOYAD | StdInChI = 1S/C19H20N6O/c26-19(24-15-5-1-3-13(11-15)17-20-7-8-21-17)25-16-6-2-4-14(12-16)18-22-9-10-23-18/h1-6,11-12H,7-10H2,(H,20,21)(H,22,23)(H2,24,25,26) | StdInChIKey = SCEVFJUWLLRELN-UHFFFAOYSA-N }} |Section2={{Chembox Properties | C=19 | H=20 | N=6 | O=1 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section6={{Chembox Pharmacology | ATCvet = yes | ATCCode_prefix = P51 | ATCCode_suffix = EX01 }} |Section7={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}
'''Imidocarb''' is a urea derivative used in veterinary medicine as an antiprotozoal agent for the treatment of infection with ''Babesia'' (babesiosis) and other parasites.<ref>{{Cite journal | pmid = 608109 | year = 1977 | last1 = Hashemi-Fesharki | first1 = R | title = Studies on imidocarb dihydrochloride in experimental Babesia ovis infection in splenectomized lambs | volume = 133 | issue = 6 | pages = 609–14 | journal = The British Veterinary Journal| doi = 10.1016/S0007-1935(17)33941-6 }}</ref><ref>{{Cite journal | pmid = 1212605 | year = 1975 | last1 = Hashemi-Fesharki | first1 = R | title = Studies on imidocarb dihydrochloride in experimental Babesia bigemina infection in calves | volume = 131 | issue = 6 | pages = 666–72 | journal = The British Veterinary Journal| doi = 10.1016/S0007-1935(17)35138-2 }}</ref><ref>{{Cite journal | pmid = 7216881 | year = 1980 | last1 = Kuttler | first1 = KL | title = Pharmacotherapeutics of drugs used in treatment of anaplasmosis and babesiosis | volume = 176 | issue = 10 Spec No | pages = 1103–8 | journal = Journal of the American Veterinary Medical Association| doi = 10.2460/javma.1980.176.10.1103 }}</ref>
==Mechanism of action== Imidocarb is anticholinergic; it inhibits acetylcholinesterase.<ref>{{cite web | url = https://go.drugbank.com/drugs/DB11521 | title = Imidocarb | access-date = November 23, 2024 | website = DrugBank}}</ref><ref>{{cite book | title = Saunders Handbook of Veterinary Drugs | edition = 4th | date = 2016 | pages = 391–392 | isbn = 978-0-323-24485-5 | publisher = Elsevier | first = Mark G. | last = Papich | doi = 10.1016/B978-0-323-24485-5.00304-1}}</ref>
==References== {{reflist}}
Category:Antiprotozoal agents Category:Ureas Category:Imidazolines
{{Antiinfective-drug-stub}}