IC-26

{{Short description|Chemical compound}} {{cs1 config|name-list-style=vanc}} {{Other uses|IC 26 (disambiguation)}} {{Drugbox | Watchedfields = changed | verifiedrevid = 420623380 | IUPAC_name = 4-ethylsulfonyl-''N'',''N''-dimethyl-4,4-diphenylbutan-2-amine | image = IC-26 structure.svg | image_class = skin-invert-image | width = 200

| tradename = | pregnancy_category = | legal_US = | routes_of_administration =

| bioavailability = | metabolism = | excretion =

| ATC_suffix = | CAS_number_Ref = {{cascite|correct|CAS}} | CAS_number = 114538-73-7 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = ZSY3T8J4AQ | CAS_supplemental = <BR>60662-79-5 (hydrochloride) | PubChem = 113832 | ChemSpiderID = 102014

| C=20 | H=27 | N=1 | O=2 | S=1 | molecular_weight = | smiles = CCS(=O)(=O)C(CC(C)N(C)C)(C1=CC=CC=C1)C2=CC=CC=C2 | StdInChI = 1S/C20H27NO2S/c1-5-24(22,23)20(16-17(2)21(3)4,18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-15,17H,5,16H2,1-4H3 | StdInChIKey = NLPGJSPLDNDKKZ-UHFFFAOYSA-N }}

'''IC-26'''<ref>{{cite journal | vauthors = Tullar BF, Wetterau W, Archer S | title=The Resolution of Ethyl 1,1-Diphenyl-3-dimethylaminobutyl Sulfone | journal=Journal of the American Chemical Society | date=November 1948 | volume=70 | issue=11 | pages=3959–3960 | doi=10.1021/ja01191a532| pmid=18207952 | bibcode=1948JAChS..70R3959T }}</ref> ('''WIN 1161-3,''' '''Methiodone''')<ref>{{ cite patent | country = US | status = patent | number = 2618640 | gdate = 1952-11-18 | title = Certain amino hydrocarbon sulfones and process of preparation | inventor = Archer S, Suter CM, Tullar BF | assign1 = Sterling Drug }}</ref> is an analogue of the opioid analgesic methadone, where the carbonyl group has been replaced by the bioisosteric sulfone group.

Human and animal studies suggest that IC-26 is around the same potency as methadone,<ref>{{ cite book | author = Lednicer, D. | title = Central Analgetics | year = 1982 | page = 194 | publisher = Wiley | isbn = 0-471-08314-3 }}</ref><ref>{{cite book | vauthors = Janssen PA | chapter = XVIII Sulphones | series = Synthetic Analgesics | volume = 1 | title = Diphenylpropylamines | publisher = Pergamon Press | year = 1960 | pages = 160–163 | lccn = 59-13814 | chapter-url = https://www.scribd.com/doc/16407915/Synthetic-Analgesics-Vol-1-Diphenylpropylamines-Paul-Janssen-1960#page=166 | url = https://www.scribd.com/doc/16407915/Synthetic-Analgesics-Vol-1-Diphenylpropylamines-Paul-Janssen-1960 | access-date = 2017-09-09 | archive-date = 2013-07-21 | archive-url = https://web.archive.org/web/20130721031827/http://www.scribd.com/doc/16407915/Synthetic-Analgesics-Vol-1-Diphenylpropylamines-Paul-Janssen-1960 | url-status = dead }}</ref> although other studies have found its activity to be inconsistent between different patients, with consistent opioid activity only being seen at a dose several times that of methadone. IC-26 was assessed for its abuse potential, but despite being found to have similar potential to morphine for development of dependence<ref>{{ cite journal | vauthors = Wolbach AB, Fraser HF | title = Addiction Liability of I-C-26 | journal = Bulletin on Narcotics | publisher = UNODC | year = 1963 | volume = 1963 | issue = 1 | pages = 25–28 | url = https://www.unodc.org/unodc/en/data-and-analysis/bulletin/bulletin_1963-01-01_1_page005.html }}</ref> it was never placed under international control as an illegal drug.

==See also== * Dextromoramide * Dipipanone * MT-45 * Phenadoxone

==References== {{Reflist|2}}

Category:Synthetic opioids Category:Sulfones Category:Dimethylamino compounds Category:Mu-opioid receptor agonists Category:Benzhydryl compounds