Hydroxynaphthol blue

{{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 432242693 | ImageFile = Hydroxynaphthol blue.png | OtherNames = Hydroxynaphthol blue | Section1 = {{Chembox Identifiers | CASNo_Ref = {{cascite|correct|??}} | CASNo = 63451-35-4 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = VG5SKF7S6C | PubChem = 9576626 | SMILES = O=S(C(C=C4)=CC1=C4C(/N=N/C2=C3C(C=CC=C3)=C(S(=O)(O[Na])=O)C=C2O)=C(O)C(S(=O)(O[Na])=O)=C1)(O[Na])=O | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 20157443 | InChI = 1/C20H14N2O11S3.3Na/c23-15-9-16(35(28,29)30)13-3-1-2-4-14(13)18(15)21-22-19-12-6-5-11(34(25,26)27)7-10(12)8-17(20(19)24)36(31,32)33;;;/h1-9,23-24H,(H,25,26,27)(H,28,29,30)(H,31,32,33);;;/q;3*+1/p-3/b22-21+;;; | InChIKey = AUIINJJXRXMPGT-QWKJSYRZBJ | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C20H14N2O11S3.3Na/c23-15-9-16(35(28,29)30)13-3-1-2-4-14(13)18(15)21-22-19-12-6-5-11(34(25,26)27)7-10(12)8-17(20(19)24)36(31,32)33;;;/h1-9,23-24H,(H,25,26,27)(H,28,29,30)(H,31,32,33);;;/q;3*+1/p-3/b22-21+;;; | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = AUIINJJXRXMPGT-ZRUFZDNISA-K }} | Section2 = {{Chembox Properties | Formula = C₂₀H₁₁N₂Na₃O₁₁S₃ | MolarMass = 620.46301 g/mol | Appearance = Black-violet Powder | Density = | MeltingPt = | BoilingPt = | Solubility = Soluble | pKa = 6.44, 12.93<ref>{{cite journal |author1=Atuko Itoh|author2=Keihei Ueno| title = Evaluation of 2-hydroxy-1-(20hydroxy-4-sulpho-1-naphthylazo)-3-naphthoic acid and hydroxynaphtol blue as metallochromic indicators in the EDTA titration of calcium | journal = Analyst | issn = 1364-5528 | year = 1970| volume = 95 |issue=1131 | pages = 583&ndash;589 |doi=10.1039/an9709500583 |bibcode=1970Ana....95..583I | url = https://pubs.rsc.org/en/content/articlelanding/1970/AN/an9709500583| url-access = subscription }}</ref> }} }}

'''Hydroxynaphthol blue''' is an azo dye. It is used for determining the endpoint in complexometric titrations/Metal Titration.

==References== {{Reflist}}

Category:Azo dyes Category:Naphthalenesulfonates Category:Organic sodium salts Category:2-Naphthols

{{OrganicAcid-stub}}