Hopane

{{Chembox | Name = | Reference = <ref>{{cite web | url = http://www.chem.qmul.ac.uk/iupac/sectionF/terpenoid/terp25a.html | title = Hopane | archive-url = https://web.archive.org/web/20110609012855/http://www.chem.qmul.ac.uk/iupac/sectionF/terpenoid/terp25a.html | archive-date = 2011-06-09 | url-status = dead | access-date = 2021-03-30 | website = IUPAC Recommendations 1999, Revised Section F: Natural Products and Related Compounds | date = 1999 }}</ref> | ImageFile = hopane.svg | ImageSize = | IUPACName = Hopane<ref>{{cite book |author=International Union of Pure and Applied Chemistry |date=2014 |title=Nomenclature of Organic Chemistry: IUPAC Recommendations and Preferred Names 2013 |publisher=The Royal Society of Chemistry |pages=1536 |doi=10.1039/9781849733069 |isbn=978-0-85404-182-4}}</ref> | SystematicName = (3''R'',3a''S'',5a''R'',5b''R'',7a''S'',11a''S'',11b''R'',13a''R'',13b''S'')-5a,5b,8,8,11a,13b-Hexamethyl-3-(propan-2-yl)icosahydro-1''H''-cyclopenta[''a'']chrysene | OtherNames = A'-Neogammacerane | Section1 = {{Chembox Identifiers | CASNo = 471-62-5 | CASNo_Ref = {{cascite|correct|}} | UNII_Ref = {{fdacite|correct|FDA}} | UNII = W2H93796GT | PubChem = 10115 | ChemSpiderID = 9711 | SMILES = [C@@H]54[C@]([C@@H]3[C@@]([C@]1([C@@H]([C@]2(C)[C@@H](CC1)C(C)(C)CCC2)CC3)C)(C)CC4)(C)CC[C@@H]5C(C)C | InChI = 1/C30H52/c1-20(2)21-12-17-27(5)22(21)13-18-29(7)24(27)10-11-25-28(6)16-9-15-26(3,4)23(28)14-19-30(25,29)8/h20-25H,9-19H2,1-8H3/t21-,22+,23+,24-,25-,27+,28+,29-,30-/m1/s1 | InChIKey = ZRLNBWWGLOPJIC-PYQRSULMBH | StdInChI = 1S/C30H52/c1-20(2)21-12-17-27(5)22(21)13-18-29(7)24(27)10-11-25-28(6)16-9-15-26(3,4)23(28)14-19-30(25,29)8/h20-25H,9-19H2,1-8H3/t21-,22+,23+,24-,25-,27+,28+,29-,30-/m1/s1 | StdInChIKey = ZRLNBWWGLOPJIC-PYQRSULMSA-N }} | Section2 = {{Chembox Properties | C=30 | H=52 | Appearance = | Density = 0.952 g/ml | MeltingPt = | BoilingPt = | Solubility = }} | Section3 = {{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} | Section4 = | Section5 = | Section6 = }}

'''Hopane''' is a natural chemical compound classified as a triterpene. It forms the central core of a variety of other chemical compounds which are collectively known as hopanoids. The first compound of the hopane family to be isolated and characterised was hydroxyhopanone, found in dammar resin.<ref name=Mills_1955>{{cite journal |author1=Mills J.S. |author2=Werner A.E.A. | title = The Chemistry of Dammar Resin | journal = Journal of the Chemical Society | pages = 3132–40 | year = 1955|doi=10.1039/jr9550003132 }}</ref> The name derives from ''Hopea'', a tree genus from which dammar is obtained.<ref>{{cite journal | first1 = Mohamad | last1 = Pauzi Zakaria | first2 = Suhaimi | last2 = Suratman | first3 = Nor | last3 =Sayzwani Sukri | first4 = Vahab | last4 = Vaezzadeh | first5 = Chu | last5 = Wei Bong | title = APPLICATION OF PENTACYCLIC TRITERPANES AS A BIOMARKER IN IDENTIFYING THE SOURCE OF OIL POLLUTION IN THE EAST COAST OF PENINSULAR MALAYSIA | journal = Perintis | date = 2017 | volume = 7 | number = 2 | pages = 95–110}}</ref>

==See also== * Bacteriohopanepolyol

==References== {{reflist}}

Category:Triterpenes Category:Hydrocarbons Category:Cyclopentanes Category:Isopropyl compounds Category:Hopanes