Homolycorine

{{chembox | Verifiedfields = changed | verifiedrevid = | ImageFile=Homolycorine.svg | ImageSize=200px | IUPACName = 9,10-Dimethoxy-1-methyllycorenan-7-one | SystematicName = (5a''R'',11b''S'',11c''S'')-9,10-Dimethoxy-1-methyl-2,3,5,5a,11b,11c-hexahydro[2]benzopyrano[3,4-''g'']indol-7(1''H'')-one | OtherNames = |Section1={{Chembox Identifiers | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 141017 | InChI = | InChIKey = | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = InChI=1S/C18H21NO4/c1-19-7-6-10-4-5-13-16(17(10)19)11-8-14(21-2)15(22-3)9-12(11)18(20)23-13/h4,8-9,13,16-17H,5-7H2,1-3H3/t13-,16-,17-/m1/s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = WXZAKVLYZHWSNF-KBRIMQKVSA-N | CASNo_Ref = {{cascite|changed|??}} | CASNo= 477-20-3 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = T95J9AUU63 | ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL = 1221973 | PubChem=160473 | ChEBI_Ref = {{ebicite|correct|EBI}} | ChEBI = | SMILES = COc1cc2[C@@H]3[C@@H](CC=C4CCN(C)[C@@H]34)OC(=O)c2cc1OC}} |Section2={{Chembox Properties | C=18 | H=21 | N=1 | O=4 | Appearance= | Density= | MeltingPt= | BoilingPt= | Solubility= }} |Section3={{Chembox Hazards | MainHazards= | FlashPt= | AutoignitionPt = }} }}

'''Homolycorine''' is one of a number of toxic alkaloids found in various Amaryllidaceae species such as daffodils (''Narcissus'').

== Sources == * [http://europepmc.org/abstract/MED/24526460 Four new Amaryllidaceae alkaloids from Zephyranthes candida. Shitara N, Hirasawa Y, Hasumi S, Sasaki T, Matsumoto M, Wong CP, Kaneda T, Asakawa Y, Morita H (2014 Jul) Journal of natural medicines, 68(3):610-4] * [http://scripts.iucr.org/cgi-bin/paper?cf1288 Acta Crystallographica] * [http://pubs.rsc.org/en/content/articlelanding/1955/JR/jr9550001066#!divAbstract T. Kitagawa, W. I. Taylor, S. Uyeo and H. Yajima. The constitution of homolycorine and lycorenine J. Chem. Soc., 1955, 1066-1068 DOI: 10.1039/JR9550001066] * {{Cite book|last1=Bastida|first1=Jaume|last2=Lavilla|first2=Rodolfo|last3=Viladomat|first3=Francesc Viladomat|editor1-last=Cordell|editor1-first=G. A.|title=Chemical and biological aspects of "Narcissus" alkaloids|date=2006|volume=63|pages=87–179|doi=10.1016/S1099-4831(06)63003-4|pmid=17133715|series=The Alkaloids: Chemistry and Biology|pmc=7118783|isbn=9780124695634}}

Category:Lactones Category:Alkaloids category:Dihydroisocoumarins Category:Phenol ethers Category:Nitrogen heterocycles