{{Chembox | ImageFile = Ocean propanal.svg | ImageSize = 200px | ImageClass = skin-invert | IUPACName = 3-(1,3-Benzodioxol-5-yl)-2-methylpropanal | OtherNames = 2-Methyl-3-(3,4-methylenedioxyphenyl)propanal;<BR>2-piperonylpropanal<BR>Helional<BR>Ocean propanal<BR>Tropional | Section1 = {{Chembox Identifiers | CASNo = 1205-17-0 | CASNo_Ref = {{cascite|correct|CAS}} | UNII_Ref = {{fdacite|correct|FDA}} | UNII = L65EG8H6PA | PubChem = 64805 | ChemSpiderID = 58337 | SMILES = CC(CC1=CC2=C(C=C1)OCO2)C=O | InChI = 1/C11H12O3/c1-8(6-12)4-9-2-3-10-11(5-9)14-7-13-10/h2-3,5-6,8H,4,7H2,1H3 | InChIKey = BOPPSUHPZARXTH-UHFFFAOYAR | StdInChI = 1S/C11H12O3/c1-8(6-12)4-9-2-3-10-11(5-9)14-7-13-10/h2-3,5-6,8H,4,7H2,1H3 | StdInChIKey = BOPPSUHPZARXTH-UHFFFAOYSA-N }} | Section2 = {{Chembox Properties | C=11|H=12|O=3 | Appearance = Colorless liquid | Odor = floral, herbaceous | Density = 1.162 g/cm<sup>3</sup> | MeltingPt = | BoilingPtC = 282 | Solubility = }} | Section3 = {{Chembox Hazards | ExternalSDS = <ref name="sigma">{{Sigma-Aldrich|id=W523909|name=2-methyl-3-(3,4-methylenedioxyphenyl)propanal|accessdate=2016-03-02}}</ref> | GHSPictograms = {{GHS07}} | GHSSignalWord = Warning | HPhrases = {{H-phrases|315|319|335}} | PPhrases = {{P-phrases|261|305+351+338}} | MainHazards = | FlashPt = | AutoignitionPt = }} | Section4 = {{Chembox Legal status | legal_AU = | legal_BR = D1 | legal_BR_comment = <ref>{{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-15 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-04-04}}</ref> | legal_US = | legal_UK = | legal_UN = }} }}
'''Helional''' (from heliotropin, from which is it commonly derived) is a chemical compound used as a perfume in soap and laundry detergent. Its aroma is described as "watery, fresh, green, ozone, cyclamen, hay".<ref>{{cite web |title=ocean propanal|url=https://scentsandflavors.com/database/9dbb4fc0-d643-4fc7-88ee-8075b686e890|website=Scents and Flavors |publisher=Scents and Flavors |access-date=3 April 2026}}</ref> Chemically it is an aldehyde with a hydrocinnamaldehyde motif; a structural element which is present in a number of other important commercial fragrances and odorants.<ref>{{cite journal|title=Specificity and sensitivity of a human olfactory receptor functionally expressed in human embryonic kidney 293 cells and Xenopus laevis oocytes|author1=Wetzel, Christian H. |author2=Oles, Markus |author3=Wellerdieck, Christiane |author4=Kuczkowiak, Michael |author5=Gisselmann, Gunter |author6=Hatt, Hanns |journal=Journal of Neuroscience|year=1999|volume=19|issue=1|pages=7426–7433|doi=10.1093/chemse/bji002|pmid=15647465|doi-access=free}}</ref>
==Synthesis== Several synthetic routes exist but the most common is a crossed-aldol condensation between piperonal (heliotropin) and propanal followed by selective hydrogenation of the intermediate alkene. This produces a racemic product.
==See also== *Cyclamen aldehyde *Lilial *Hexyl cinnamaldehyde
==References== {{Reflist}}
Category:Benzodioxoles Category:Aldehydes Category:Perfume ingredients
{{Ether-stub}}