{{Chembox <!-- Images --> | ImageFile = Haemanthamine.svg | ImageSize = 150px <!-- Names --> | IUPACName = 3β-Methoxy-1,2-didehydro-5α,13α,19α-crinan-11β-ol | SystematicName = (3''S'',4a''S'',5''S'',11b''S'',12''R'')-3-Methoxy-4,4a-dihydro-3''H'',6''H'',9''H''-5,11b-ethano[1,3]dioxolo[4,5-''j'']phenanthridin-12-ol | OtherNames = Hemanthamine <!-- Sections --> | Section1 = {{Chembox Identifiers | CASNo = 466-75-1 | ChEBI = 5600 | ChEMBL = 401114 | ChemSpiderID = 390261 | EC_number = 884-578-7 | KEGG_Ref = {{keggcite|correct|kegg}} | KEGG = C08527 | PubChem = 441593 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = VBL6HZX2ZB | StdInChI=1S/C17H19NO4/c1-20-11-2-3-17-12-6-14-13(21-9-22-14)4-10(12)7-18(8-16(17)19)15(17)5-11/h2-4,6,11,15-16,19H,5,7-9H2,1H3/t11-,15+,16+,17+/m1/s1 | StdInChIKey = YGPRSGKVLATIHT-HSHDSVGOSA-N | SMILES = CO[C@H]1C[C@H]2[C@@]3(C=C1)[C@H](CN2CC4=CC5=C(C=C34)OCO5)O }} | Section2 = {{Chembox Properties | C=17|H=19|N=1|O=4 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} | Section3 = {{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}

'''Haemanthamine''' is a crinine-like alkaloid from the Amaryllidaceae plant family.<ref>{{cite web|title=hemanthamine|url=https://www.ncbi.nlm.nih.gov/mesh/67462104|website=MeSH Database|publisher=National Center for Biotechnology Information}}</ref>

==References == {{reflist}}

Category:Quinoline alkaloids Category:Isoquinoline alkaloids Category:Tertiary amines Category:Benzodioxoles Category:Heterocyclic compounds with 5 rings Category:Methoxy compounds

{{alkaloid-stub}}