{{One source|date=February 2025}}{{chembox | Verifiedfields = | verifiedrevid = | Name = Granatin A | ImageFile = Granatin A.PNG | ImageName = Chemical structure of granatin A | IUPACName = 6,7,8,11,12,13,25,26,30,30,31,37-Dodecahydroxy-17,21,36,38,39-pentaoxaoctacyclo[18.16.1.1<sup>2,19</sup>.1<sup>27,31</sup>.0<sup>4,9</sup>.0<sup>10,15</sup>.0<sup>23,28</sup>.0<sup>29,34</sup>]nonatriaconta-4,6,8,10,12,14,23,25,27,33-decaene-3,16,22,32,3 5-pentone | OtherNames = |Section1={{Chembox Identifiers | CASNo_Ref = | CASNo = 161205-11-4 | ChemSpiderID = 35014772 | PubChem = 131752596 | ChEMBL_Ref = | ChEMBL = | StdInChI=1S/C34H24O22/c35-10-1-6-15(23(43)20(10)40)16-7(2-11(36)21(41)24(16)44)30(46)52-5-13-26-25(45)29(28(53-13)19(6)39)55-32(48)9-4-14(38)34(51)33(49,50)18(9)17-8(31(47)54-26)3-12(37)22(42)27(17)56-34/h1-4,13,18,25-26,28-29,35-37,40-45,49-51H,5H2 | StdInChIKey = BEAQEKRAXFQCBO-UHFFFAOYSA-N | SMILES = C1C2C3C(C(C(O2)C(=O)C4=CC(=C(C(=C4C5=C(C(=C(C=C5C(=O)O1)O)O)O)O)O)O)OC(=O)C6=CC(=O)C7(C(C6C8=C(O7)C(=C(C=C8C(=O)O3)O)O)(O)O)O)O }} |Section2={{Chembox Properties | Formula = C<sub>34</sub>H<sub>24</sub>O<sub>22</sub> | MolarMass = 784.54 g/mol | Appearance = | Density= | MeltingPt= | BoilingPt= | Solubility = }} |Section3={{Chembox Hazards | MainHazards= | FlashPt= | AutoignitionPt = }} }} '''Granatin A''' is an ellagitannin found in the pericarp of ''Punica granatum'' (pomegranate).<ref name=Satomi>{{Cite journal | last1 = Satomi | first1 = H. | last2 = Umemura | first2 = K. | last3 = Ueno | first3 = A. | last4 = Hatano | first4 = T. | last5 = Okuda | first5 = T. | last6 = Noro | first6 = T. | title = Carbonic anhydrase inhibitors from the pericarps of Punica granatum L | journal = Biological & Pharmaceutical Bulletin | volume = 16 | issue = 8 | pages = 787–790 | year = 1993 | pmid = 8220326 | doi=10.1248/bpb.16.787 | doi-access = free }}</ref> It is a weak carbonic anhydrase inhibitor.<ref name=Satomi/>
== References == {{Reflist}}
== External links == * [http://www.hmdb.ca/metabolites/HMDB39271 Granatin A at the Human Metabolome Database]
{{ellagitannin}} {{Pomegranate ellagitannin}}
Category:Pomegranate ellagitannins
{{aromatic-stub}}