{{cs1 config|name-list-style=vanc|display-authors=6}} {{Infobox drug | drug_name = | image = GYKI-32887.svg | image_class = skin-invert-image | width = 250px | caption =
<!-- Clinical data --> | pronounce = | tradename = | Drugs.com = | MedlinePlus = | licence_CA = | licence_EU = | DailyMedID = | licence_US = | pregnancy_AU = | pregnancy_category = | dependency_liability = | addiction_liability = | routes_of_administration = | class = Dopamine agonist; Antiparkinsonian agent | ATC_prefix = None | ATC_suffix =
<!-- Legal status --> | legal_status =
<!-- Pharmacokinetic data --> | bioavailability = | protein_bound = | metabolism = | metabolites = | onset = | elimination_half-life = | duration_of_action = | excretion =
<!-- Identifiers --> | CAS_number = | CAS_supplemental = <br />78463-86-2 (maleate) | PubChem = 174135 | PubChemSubstance = | IUPHAR_ligand = | DrugBank = | ChemSpiderID = 151934 | UNII = | KEGG = | ChEBI = | ChEMBL = | NIAID_ChemDB = | PDB_ligand = | synonyms = GYKI32887; RGH-7825; RGH7825; 8-((''N''-2-Azidoethyl-''N''-methylsulfonylamino)methyl)-6-methylergol-8-ene
<!-- Chemical data --> | IUPAC_name = ''N''-<nowiki>[[</nowiki>(6''aR'',10''aR'')-7-methyl-6,6''a'',8,10''a''-tetrahydro-4''H''-indolo[4,3-fg]quinolin-9-yl]methyl]-''N''-(2-azidoethyl)methanesulfonamide | C=19 | H=24 | N=6 | O=2 | S=1 | SMILES = CN1CC(=C[C@H]2[C@H]1CC3=CNC4=CC=CC2=C34)CN(CCN=[N+]=[N-])S(=O)(=O)C | StdInChI = 1S/C19H24N6O2S/c1-24-11-13(12-25(28(2,26)27)7-6-22-23-20)8-16-15-4-3-5-17-19(15)14(10-21-17)9-18(16)24/h3-5,8,10,16,18,21H,6-7,9,11-12H2,1-2H3/t16-,18-/m1/s1 | StdInChIKey = KHWYJNRYIAULDT-SJLPKXTDSA-N }}
'''GYKI-32887''', also known as '''RGH-7825''', is a dopamine agonist and antiparkinsonian agent of the ergoline family which was never marketed.<ref name="Negwer_2001">{{cite book | vauthors = Negwer M | title = Organic-chemical Drugs and Their Synonyms: An International Survey | date = 2001 | publisher = Wiley-VCH | isbn = 978-3-527-30247-5 | url = https://books.google.com/books?id=zmpqAAAAMAAJ&q=%2522GYKI-32887%2522 | access-date = 30 June 2025 }}</ref><ref name="Karacsony_1983">{{cite journal | vauthors = Borsy J, Király I, Magó-Karácsony E, Bagdy E, Berzétei I | date = 1983 | title = Psychopharmacological Effects of a New Dopaminergic Agonist Compound GYK-32887. | journal = Acta Pharmaceutica Suecica | pages = 190–194 | url = https://scholar.google.com/scholar?cluster=4486869655604559584 }}</ref><ref name="Kiraly_1984">{{cite journal | vauthors = Király I, Van Ree JM | title = Non-opiate beta-endorphin fragments and dopamine--VI. Behavioural analysis of the interaction between gamma-type endorphins and dopaminergic systems in the nucleus accumbens of rats | journal = Neuropharmacology | volume = 23 | issue = 5 | pages = 511–516 | date = May 1984 | pmid = 6204246 | doi = 10.1016/0028-3908(84)90023-6 }}</ref><ref name="Nogradi_1985">{{cite journal | vauthors = Nógrádi M | date = 1985 | title = RGH-7825 | journal = Drugs of the Future | volume = 10 | issue = 9 | page = 753 | doi = 10.1358/dof.1985.010.09.71741 | url = https://hero.epa.gov/hero/index.cfm/reference/details/reference_id/6836532 }}</ref> It has a lysergamide-like structure but is not technically a lysergamide itself.<ref name="Negwer_2001" /> Similarly to other D<sub>2</sub>-like receptor agonists, direct injection of small doses of GYK-32887 into the nucleus accumbens decreases locomotor activity in rodents.<ref name="Kiraly_1984" /> This effect can be blocked by D<sub>2</sub>-like receptor antagonists like haloperidol, fluphenazine, and sulpiride.<ref name="Kiraly_1984" /> GYKI-32887 was first described in the scientific literature by 1983.<ref name="Karacsony_1983" /><ref name="Kiraly_1984" /><ref name="Nogradi_1985" />
==See also== * Disulergine * Etisulergine * Mesulergine * Quinagolide
==References== {{Reflist}}
{{Dopamine receptor modulators}} {{Ergolines}}
Category:Abandoned drugs Category:Amines Category:Dopamine agonists Category:Ergolines Category:Sulfamides
{{Nervous-system-drug-stub}}