{{chembox | Watchedfields = changed | verifiedrevid = 424693354 | Name = Fustin | ImageFile = Fustin.svg | ImageSize = 200px | IUPACName = (2''R'',3''R'')-3,3′,4′,7-Tetrahydroxyflavan-4-one | SystematicName = (2''R'',3''R'')-2-(3,4-Dihydroxyphenyl)-3,7-dihydroxy-2,3-dihydro-4''H''-1-benzopyran-4-one | OtherNames = 2,3-Dihydrofisetin<br>3,7,3',4'-Tetrahydroxyflavanone<br>2,3-Dihydrofisetin<br>3′,4′,7-Trihydroxyflavanol |Section1={{Chembox Identifiers | CASNo_Ref = {{cascite|correct|??}} | CASNo = 20725-03-5 | ChEBI = 5202 | ChEMBL = 470267 | ChemSpiderID = 4476304 | EINECS = 243-989-6 | KEGG = C01378 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 4994C1X19A | PubChem = 5317435 | StdInChI=1S/C15H12O6/c16-8-2-3-9-12(6-8)21-15(14(20)13(9)19)7-1-4-10(17)11(18)5-7/h1-6,14-18,20H/t14-,15+/m0/s1 | StdInChIKey = FNUPUYFWZXZMIE-LSDHHAIUSA-N | SMILES = C1=CC(=C(C=C1[C@@H]2[C@H](C(=O)C3=C(O2)C=C(C=C3)O)O)O)O }} |Section2={{Chembox Properties | C=15|H=12|O=6 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}

'''Fustin''', sometimes called "dihydrofisetin", is a flavanonol, a type of flavonoid. It can be found in young fustic (''Cotinus coggygria'')<ref>{{cite journal | doi = 10.1007/s00216-009-2767-z| pmid = 19352635| title = Phytochemical analysis of young fustic (Cotinus coggygria heartwood) and identification of isolated colourants in historical textiles| journal = Analytical and Bioanalytical Chemistry| volume = 394| issue = 3| pages = 871| year = 2009| last1 = Valianou| first1 = Lemonia| last2 = Stathopoulou| first2 = Konstantina| last3 = Karapanagiotis| first3 = Ioannis| last4 = Magiatis| first4 = Prokopios| last5 = Pavlidou| first5 = Eleni| last6 = Skaltsounis| first6 = Alexios-Leandros| last7 = Chryssoulakis| first7 = Yannis| s2cid = 22188491}}</ref> and in the lacquer tree (''Toxicodendron vernicifluum'').<ref name="Park">{{cite journal | doi = 10.1038/emm.2007.35| title = Protective effects of fustin, a flavonoid from Rhus verniciflua Stokes, on 6-hydroxydopamine-induced neuronal cell death| journal = Experimental & Molecular Medicine| volume = 39| issue = 3| pages = 316| year = 2007| last1 = Park| first1 = Byung Chul| last2 = Lee| first2 = Yong Soo| last3 = Park| first3 = Hee-Juhn| last4 = Kwak| first4 = Mi-Kyoung| last5 = Yoo| first5 = Bong Kyu| last6 = Kim| first6 = Joo Young| last7 = Kim| first7 = Jung-Ae| pmid = 17603285| doi-access = free}}</ref>

Fustin shows protective effects on 6-hydroxydopamine-induced neuronal cell death.<ref name="Park"/>

Unlike fisetin, fustin has no double bond in the C-ring. This makes fustin a flavan, with two stereocenters and four stereoisomers.

==References== {{reflist}}

{{flavanonol}}

Category:Flavanonols Category:Catechols